Attributes
UniProt ID
Protein Name
Glutathione S-transferase Mu 1
Ligand Name
L-gamma-glutamyl-S-[(9S,10S)-10-hydroxy-9,10-dihydrophenanthren-9-yl]-L-cysteinylglycine
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JNNIZILNBMPOAC-GPHNJDIKSA-N
SMILES
c1ccc2c(c1)-c3ccccc3C(C2O)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2GST
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2gstA1e2gstA2e2gstB1e2gstB2
ECOD domains from experimental PDB structures interacting with ligand DB04187
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04905 | DB04187 | GPS | 2gst | e2gstA1 | A:85-217 |
| P04905 | DB04187 | GPS | 2gst | e2gstA2 | A:1-84 |
| P04905 | DB04187 | GPS | 2gst | e2gstB1 | B:85-217 |
| P04905 | DB04187 | GPS | 2gst | e2gstB2 | B:1-84 |
| P04905 | DB04187 | GPS | 6gsu | e6gsuA1 | A:85-217 |
| P04905 | DB04187 | GPS | 6gsu | e6gsuA2 | A:1-84 |
| P04905 | DB04187 | GPS | 6gsu | e6gsuB1 | B:85-217 |
| P04905 | DB04187 | GPS | 6gsu | e6gsuB2 | B:1-84 |
| P04905 | DB04187 | GPS | 6gsv | e6gsvA1 | A:85-217 |
| P04905 | DB04187 | GPS | 6gsv | e6gsvA2 | A:1-84 |
| P04905 | DB04187 | GPS | 6gsv | e6gsvB1 | B:85-217 |
| P04905 | DB04187 | GPS | 6gsv | e6gsvB2 | B:1-84 |
| P04905 | DB04187 | GPS | 6gsw | e6gswA1 | A:85-217 |
| P04905 | DB04187 | GPS | 6gsw | e6gswA2 | A:1-84 |
| P04905 | DB04187 | GPS | 6gsw | e6gswB1 | B:85-217 |
| P04905 | DB04187 | GPS | 6gsw | e6gswB2 | B:1-84 |
| P04905 | DB04187 | GPS | 6gsx | e6gsxA1 | A:85-217 |
| P04905 | DB04187 | GPS | 6gsx | e6gsxA2 | A:1-84 |
| P04905 | DB04187 | GPS | 6gsx | e6gsxB1 | B:85-217 |
| P04905 | DB04187 | GPS | 6gsx | e6gsxB2 | B:1-84 |