Attributes
UniProt ID
Protein Name
Sodium/potassium-transporting ATPase subunit alpha-1 /K ATPase alpha-1 subunit
Ligand Name
1,2-DIOLEOYL-SN-GLYCERO-3-PHOSPHOCHOLINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SNKAWJBJQDLSFF-NVKMUCNASA-O
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7D91
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7d91A1e7d91A2e7d91A3e7d91A4e7d91B1e7d91B2e7d91G1
ECOD domains from experimental PDB structures interacting with ligand DB03690
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05024 | DB03690 | PCW | 7d91 | e7d91A2 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7d92 | e7d92A2 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7d93 | e7d93A3 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7d93 | e7d93C2 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7d94 | e7d94A1 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7d94 | e7d94C3 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7ddf | e7ddfA3 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7ddf | e7ddfC3 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7ddh | e7ddhA1 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7ddh | e7ddhC1 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7ddi | e7ddiA2 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7ddi | e7ddiC4 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7ddk | e7ddkA1 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7ddk | e7ddkC4 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7ddl | e7ddlA2 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7ddl | e7ddlC2 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7wys | e7wysA4 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7wys | e7wysC1 | C:21-144,C:271-361,C:758-1016 |
| P05024 | DB03690 | PCW | 7wyt | e7wytA4 | A:21-144,A:271-361,A:758-1016 |
| P05024 | DB03690 | PCW | 7wyt | e7wytC1 | C:21-144,C:271-361,C:758-1016 |