Attributes
UniProt ID
Protein Name
Arginase-1
Ligand Name
2(S)-AMINO-6-BORONOHEXANOIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BLVGFZFOWWBCCZ-YFKPBYRVSA-N
SMILES
[B-](CCCCC(C(=O)O)N)(O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2AEB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2aebA1e2aebB1
ECOD domains from experimental PDB structures interacting with ligand DB01983
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05089 | DB01983 | ABH | 2aeb | e2aebA1 | A:5-313 |
| P05089 | DB01983 | ABH | 2aeb | e2aebB1 | B:5-313 |
| P05089 | DB01983 | ABH | 2pll | e2pllA1 | A:5-313 |
| P05089 | DB01983 | ABH | 2pll | e2pllB1 | B:5-313 |
| P05089 | DB01983 | ABH | 3e6k | e3e6kA1 | A:6-313 |
| P05089 | DB01983 | ABH | 3e6k | e3e6kB1 | B:6-313 |
| P05089 | DB01983 | ABH | 3e6v | e3e6vA1 | A:6-319 |
| P05089 | DB01983 | ABH | 3e6v | e3e6vB1 | B:6-319 |
| P05089 | DB01983 | ABH | 3thh | e3thhA1 | A:6-319 |
| P05089 | DB01983 | ABH | 3thh | e3thhB1 | B:6-319 |
| P05089 | DB01983 | ABH | 4gsv | e4gsvA1 | A:1-313 |
| P05089 | DB01983 | ABH | 4gsv | e4gsvB1 | B:1-313 |
| P05089 | DB01983 | ABH | 4gsz | e4gszA1 | A:1-313 |
| P05089 | DB01983 | ABH | 4gsz | e4gszB1 | B:1-313 |
| P05089 | DB01983 | ABH | 4gwd | e4gwdA1 | A:1-313 |
| P05089 | DB01983 | ABH | 4gwd | e4gwdB1 | B:1-313 |
| P05089 | DB01983 | ABH | 6q92 | e6q92A1 | A:2-319 |
| P05089 | DB01983 | ABH | 6q92 | e6q92B1 | B:2-319 |
| P05089 | DB01983 | ABH | 6q9p | e6q9pA1 | A:7-319 |
| P05089 | DB01983 | ABH | 6q9p | e6q9pB1 | B:7-315 |