Attributes
UniProt ID
Protein Name
cAMP-dependent protein kinase catalytic subunit alpha
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1JBP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1jbpE1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05132 | DB16833 | ADP | 1jbp | e1jbpE1 | E:9-350 |
| P05132 | DB16833 | ADP | 1l3r | e1l3rE1 | E:1-350 |
| P05132 | DB16833 | ADP | 1rdq | e1rdqE1 | E:1-350 |
| P05132 | DB16833 | ADP | 2qur | e2qurA1 | A:11-350 |
| P05132 | DB16833 | ADP | 4dh5 | e4dh5A2 | A:15-350 |
| P05132 | DB16833 | ADP | 4iad | e4iadA1 | A:14-350 |
| P05132 | DB16833 | ADP | 4iaf | e4iafA1 | A:15-350 |
| P05132 | DB16833 | ADP | 4iai | e4iaiA1 | A:15-350 |
| P05132 | DB16833 | ADP | 4iak | e4iakA1 | A:14-350 |
| P05132 | DB16833 | ADP | 4iay | e4iayA1 | A:15-350 |
| P05132 | DB16833 | ADP | 4iaz | e4iazA1 | A:14-350 |
| P05132 | DB16833 | ADP | 4ib0 | e4ib0A1 | A:14-350 |
| P05132 | DB16833 | ADP | 4ib1 | e4ib1A1 | A:13-350 |
| P05132 | DB16833 | ADP | 4ib3 | e4ib3A1 | A:12-350 |
| P05132 | DB16833 | ADP | 4ntt | e4nttA1 | A:10-350 |
| P05132 | DB16833 | ADP | 4ntt | e4nttB1 | B:10-350 |
| P05132 | DB16833 | ADP | 4o21 | e4o21A1 | A:15-350 |
| P05132 | DB16833 | ADP | 4wbb | e4wbbB1 | B:14-350 |
| P05132 | DB16833 | ADP | 4xw6 | e4xw6A1 | A:14-350 |
| P05132 | DB16833 | ADP | 5jr7 | e5jr7A1 | A:13-350 |
| P05132 | DB16833 | ADP | 5jr7 | e5jr7C1 | C:13-350 |
| P05132 | DB16833 | ADP | 6e21 | e6e21A1 | A:15-350 |
| P05132 | DB16833 | ADP | 7ujx | e7ujxE1 | E:15-350 |
| P05132 | DB16833 | ADP | 7v0g | e7v0gE1 | E:16-350 |