Attributes
UniProt ID
Protein Name
cAMP-dependent protein kinase catalytic subunit alpha
Ligand Name
PHOSPHOAMINOPHOSPHONIC ACID-ADENYLATE ESTER
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PVKSNHVPLWYQGJ-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(NP(=O)(O)O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2QCS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2qcsA1e2qcsB3e2qcsB4
ECOD domains from experimental PDB structures interacting with ligand ANP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05132 | n/a | ANP | 2qcs | e2qcsA1 | A:13-350 |
| P05132 | n/a | ANP | 3fhi | e3fhiA1 | A:13-350 |
| P05132 | n/a | ANP | 3idb | e3idbA1 | A:8-350 |
| P05132 | n/a | ANP | 3idc | e3idcA1 | A:8-350 |
| P05132 | n/a | ANP | 3o7l | e3o7lB1 | B:17-350 |
| P05132 | n/a | ANP | 3pvb | e3pvbA1 | A:6-350 |
| P05132 | n/a | ANP | 4dfx | e4dfxE1 | E:1-350 |
| P05132 | n/a | ANP | 4dg0 | e4dg0E2 | E:10-350 |
| P05132 | n/a | ANP | 4dg3 | e4dg3E1 | E:14-350 |
| P05132 | n/a | ANP | 4dh7 | e4dh7A2 | A:15-350 |
| P05132 | n/a | ANP | 4dh8 | e4dh8A2 | A:15-350 |
| P05132 | n/a | ANP | 4hpt | e4hptE2 | E:14-350 |
| P05132 | n/a | ANP | 4hpu | e4hpuE1 | E:12-350 |
| P05132 | n/a | ANP | 4xw4 | e4xw4A1 | A:14-350 |
| P05132 | n/a | ANP | 6mm5 | e6mm5E1 | E:13-350 |
| P05132 | n/a | ANP | 6mm6 | e6mm6C1 | C:18-350 |
| P05132 | n/a | ANP | 6mm6 | e6mm6E1 | E:18-350 |
| P05132 | n/a | ANP | 6mm7 | e6mm7A1 | A:16-350 |
| P05132 | n/a | ANP | 6mm7 | e6mm7D1 | D:15-350 |
| P05132 | n/a | ANP | 6mm8 | e6mm8C1 | C:14-350 |
| P05132 | n/a | ANP | 7e0z | e7e0zA1 | A:13-350 |
| P05132 | n/a | ANP | 7e11 | e7e11A1 | A:13-350 |
| P05132 | n/a | ANP | 7e12 | e7e12A1 | A:18-350 |