Attributes
UniProt ID
Protein Name
cAMP-dependent protein kinase catalytic subunit alpha
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1ATP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1atpE1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05132 | DB00171 | ATP | 1atp | e1atpE1 | E:15-350 |
| P05132 | DB00171 | ATP | 1rdq | e1rdqE1 | E:1-350 |
| P05132 | DB00171 | ATP | 3fjq | e3fjqE1 | E:15-350 |
| P05132 | DB00171 | ATP | 3qal | e3qalE1 | E:1-350 |
| P05132 | DB00171 | ATP | 3qam | e3qamE1 | E:1-350 |
| P05132 | DB00171 | ATP | 3x2u | e3x2uA1 | A:12-350 |
| P05132 | DB00171 | ATP | 3x2v | e3x2vA1 | A:17-350 |
| P05132 | DB00171 | ATP | 3x2w | e3x2wA1 | A:12-350 |
| P05132 | DB00171 | ATP | 4dh1 | e4dh1A2 | A:15-350 |
| P05132 | DB00171 | ATP | 4dh3 | e4dh3A2 | A:15-350 |
| P05132 | DB00171 | ATP | 4din | e4dinA2 | A:9-350 |
| P05132 | DB00171 | ATP | 4x6r | e4x6rA1 | A:1-350 |
| P05132 | DB00171 | ATP | 4xw5 | e4xw5A1 | A:14-350 |