Attributes
UniProt ID
Protein Name
Myeloperoxidase
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6WXZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6wxzB1e6wxzE1
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05164 | DB03317 | HEC | 6wxz | e6wxzB1 | B:114-577 |
| P05164 | DB03317 | HEC | 6wxz | e6wxzE1 | E:113-577 |
| P05164 | DB03317 | HEC | 6wy0 | e6wy0B1 | B:114-577 |
| P05164 | DB03317 | HEC | 6wy0 | e6wy0E1 | E:113-577 |
| P05164 | DB03317 | HEC | 6wy0 | e6wy0G1 | G:114-577 |
| P05164 | DB03317 | HEC | 6wy0 | e6wy0I1 | I:113-577 |
| P05164 | DB03317 | HEC | 6wy5 | e6wy5B1 | B:114-577 |
| P05164 | DB03317 | HEC | 6wy5 | e6wy5E1 | E:113-577 |
| P05164 | DB03317 | HEC | 6wy7 | e6wy7B1 | B:113-577 |
| P05164 | DB03317 | HEC | 6wy7 | e6wy7E1 | E:114-577 |
| P05164 | DB03317 | HEC | 6wyd | e6wydB1 | B:113-577 |
| P05164 | DB03317 | HEC | 6wyd | e6wydE1 | E:113-577 |
| P05164 | DB03317 | HEC | 6wyd | e6wydG1 | G:113-577 |
| P05164 | DB03317 | HEC | 6wyd | e6wydI1 | I:113-577 |
| P05164 | DB03317 | HEC | 7qzr | e7qzrB1 | B:279-744 |
| P05164 | DB03317 | HEC | 7qzr | e7qzrD1 | D:279-743 |
| P05164 | DB03317 | HEC | 7z53 | e7z53B1 | B:279-743 |
| P05164 | DB03317 | HEC | 7z53 | e7z53D1 | D:279-743 |
| P05164 | DB03317 | HEC | 7z53 | e7z53H1 | H:279-744 |
| P05164 | DB03317 | HEC | 7z53 | e7z53J1 | J:279-743 |
| P05164 | DB03317 | HEC | 7z53 | e7z53N1 | N:279-743 |
| P05164 | DB03317 | HEC | 7z53 | e7z53P1 | P:279-743 |
| P05164 | DB03317 | HEC | 7z53 | e7z53T1 | T:279-743 |
| P05164 | DB03317 | HEC | 7z53 | e7z53V1 | V:279-744 |