Attributes
UniProt ID
Protein Name
Photosystem I P700 chlorophyll a apoprotein A1
Ligand Name
BETA-CAROTENE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OENHQHLEOONYIE-JLTXGRSLSA-N
SMILES
CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2O01
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2o0111e2o0121e2o0131e2o0141e2o01A1e2o01A2e2o01B1e2o01B2e2o01C1e2o01D1e2o01E1e2o01F1e2o01G1e2o01H1e2o01I1e2o01J1e2o01L1e2o01N1
ECOD domains from experimental PDB structures interacting with ligand DB06755
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05310 | DB06755 | BCR | 2o01 | e2o01A2 | A:427-758 |
| P05310 | DB06755 | BCR | 2wsc | e2wscA1 | A:21-427 |
| P05310 | DB06755 | BCR | 2wsc | e2wscA2 | A:428-758 |
| P05310 | DB06755 | BCR | 2wse | e2wseA1 | A:21-427 |
| P05310 | DB06755 | BCR | 2wse | e2wseA2 | A:428-758 |
| P05310 | DB06755 | BCR | 2wsf | e2wsfA1 | A:21-427 |
| P05310 | DB06755 | BCR | 2wsf | e2wsfA2 | A:428-758 |
| P05310 | DB06755 | BCR | 3lw5 | e3lw5A1 | A:21-427 |
| P05310 | DB06755 | BCR | 3lw5 | e3lw5A2 | A:428-758 |
| P05310 | DB06755 | BCR | 4rku | e4rkuA1 | A:38-427 |
| P05310 | DB06755 | BCR | 4rku | e4rkuA2 | A:428-758 |
| P05310 | DB06755 | BCR | 4xk8 | e4xk8A1 | A:17-419 |
| P05310 | DB06755 | BCR | 4xk8 | e4xk8A2 | A:420-758 |
| P05310 | DB06755 | BCR | 4xk8 | e4xk8a1 | a:420-758 |
| P05310 | DB06755 | BCR | 4y28 | e4y28A1 | A:17-419 |
| P05310 | DB06755 | BCR | 4y28 | e4y28A2 | A:420-758 |
| P05310 | DB06755 | BCR | 5l8r | e5l8rA1 | A:420-758 |
| P05310 | DB06755 | BCR | 5l8r | e5l8rA2 | A:16-419 |