Attributes
UniProt ID
Protein Name
Structural polyprotein
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7SFU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7sfuA1e7sfuA2e7sfuA3e7sfuC1e7sfuD1e7sfuD2e7sfuD3e7sfuF1e7sfuG1e7sfuG2e7sfuG3e7sfuI1e7sfuJ1e7sfuJ2e7sfuJ3e7sfuL1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05674 | DB00141 | NAG | 7sfu | e7sfuA2 | A:1-293 |
| P05674 | DB00141 | NAG | 7sfu | e7sfuD1 | D:1-293 |
| P05674 | DB00141 | NAG | 7sfu | e7sfuG2 | G:1-293 |
| P05674 | DB00141 | NAG | 7sfu | e7sfuJ1 | J:1-293 |
| P05674 | DB00141 | NAG | 7sfv | e7sfvA1 | A:1-293 |
| P05674 | DB00141 | NAG | 7sfv | e7sfvD1 | D:1-293 |
| P05674 | DB00141 | NAG | 7sfv | e7sfvG1 | G:1-293 |
| P05674 | DB00141 | NAG | 7sfv | e7sfvJ1 | J:1-293 |
| P05674 | DB00141 | NAG | 7sfw | e7sfwA2 | A:1-293 |
| P05674 | DB00141 | NAG | 7sfw | e7sfwD2 | D:1-293 |
| P05674 | DB00141 | NAG | 7sfw | e7sfwG2 | G:1-293 |
| P05674 | DB00141 | NAG | 7sfw | e7sfwJ1 | J:1-293 |
| P05674 | DB00141 | NAG | 8deq | e8deqA2 | A:1-293 |
| P05674 | DB00141 | NAG | 8deq | e8deqB1 | B:1-293 |
| P05674 | DB00141 | NAG | 8deq | e8deqC1 | C:1-293 |
| P05674 | DB00141 | NAG | 8deq | e8deqD1 | D:1-293 |
| P05674 | DB00141 | NAG | 8deq | e8deqE1 | E:1-293 |
| P05674 | DB00141 | NAG | 8deq | e8deqF1 | F:1-293 |
| P05674 | DB00141 | NAG | 8der | e8derE2 | E:1-293 |
| P05674 | DB00141 | NAG | 8der | e8derF1 | F:1-293 |
| P05674 | DB00141 | NAG | 8der | e8derG1 | G:1-293 |