Attributes
UniProt ID
Protein Name
Prostaglandin G/H synthase 1
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1EBV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ebvA1e1ebvA2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P05979 | DB00141 | NAG | 1ebv | e1ebvA1 | A:74-583 |
| P05979 | DB00141 | NAG | 1eqg | e1eqgA1 | A:74-583 |
| P05979 | DB00141 | NAG | 1eqg | e1eqgB1 | B:74-583 |
| P05979 | DB00141 | NAG | 1eqh | e1eqhA1 | A:74-583 |
| P05979 | DB00141 | NAG | 1eqh | e1eqhB1 | B:74-583 |
| P05979 | DB00141 | NAG | 1ht5 | e1ht5A1 | A:74-583 |
| P05979 | DB00141 | NAG | 1ht5 | e1ht5B1 | B:74-583 |
| P05979 | DB00141 | NAG | 1ht8 | e1ht8A1 | A:74-583 |
| P05979 | DB00141 | NAG | 1ht8 | e1ht8B1 | B:74-583 |
| P05979 | DB00141 | NAG | 1pge | e1pgeA1 | A:74-583 |
| P05979 | DB00141 | NAG | 1pge | e1pgeB1 | B:74-583 |
| P05979 | DB00141 | NAG | 1pgf | e1pgfA1 | A:74-583 |
| P05979 | DB00141 | NAG | 1pgf | e1pgfB1 | B:74-583 |
| P05979 | DB00141 | NAG | 1pgg | e1pggA1 | A:74-583 |
| P05979 | DB00141 | NAG | 1pgg | e1pggB1 | B:74-583 |
| P05979 | DB00141 | NAG | 1pth | e1pthA1 | A:74-583 |
| P05979 | DB00141 | NAG | 1pth | e1pthB1 | B:74-583 |
| P05979 | DB00141 | NAG | 3n8x | e3n8xA1 | A:74-584 |
| P05979 | DB00141 | NAG | 3n8x | e3n8xA2 | A:32-73 |
| P05979 | DB00141 | NAG | 3n8x | e3n8xB1 | B:74-584 |
| P05979 | DB00141 | NAG | 3n8x | e3n8xB2 | B:32-73 |
| P05979 | DB00141 | NAG | 4o1z | e4o1zA1 | A:74-584 |
| P05979 | DB00141 | NAG | 4o1z | e4o1zA2 | A:32-73 |
| P05979 | DB00141 | NAG | 4o1z | e4o1zB1 | B:74-584 |
| P05979 | DB00141 | NAG | 4o1z | e4o1zB2 | B:32-73 |