Attributes
UniProt ID
Protein Name
Reaction center protein L chain
Ligand Name
MENAQUINONE-7
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RAKQPZMEYJZGPI-LJWNYQGCSA-N
SMILES
CC1=C(C(=O)c2ccccc2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1PRC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1prcC1e1prcH1e1prcH2e1prcL1e1prcM1
ECOD domains from experimental PDB structures interacting with ligand DB13075
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06009 | DB13075 | MQ7 | 1prc | e1prcL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 2jbl | e2jblL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 2prc | e2prcL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 2wjm | e2wjmL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 2wjn | e2wjnL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 2x5u | e2x5uL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 2x5v | e2x5vL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 3prc | e3prcL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 4ac5 | e4ac5L1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 4cas | e4casB1 | B:1-273 |
| P06009 | DB13075 | MQ7 | 5m7j | e5m7jB1 | B:1-273 |
| P06009 | DB13075 | MQ7 | 5m7k | e5m7kB1 | B:1-273 |
| P06009 | DB13075 | MQ7 | 5m7l | e5m7lB1 | B:1-273 |
| P06009 | DB13075 | MQ7 | 5nj4 | e5nj4L1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 5o4c | e5o4cL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 5o64 | e5o64L1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 5prc | e5prcL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6prc | e6prcL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6zhw | e6zhwL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6zi4 | e6zi4L1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6zi5 | e6zi5L1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6zi6 | e6zi6L1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6zi9 | e6zi9L1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6zia | e6ziaL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 6zid | e6zidL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 7prc | e7prcL1 | L:1-273 |
| P06009 | DB13075 | MQ7 | 7q7p | e7q7pLLL1 | LLL:1-273 |