Attributes
UniProt ID
Protein Name
n/a
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1LGR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1lgrA1e1lgrA2e1lgrB1e1lgrB2e1lgrC1e1lgrC2e1lgrD1e1lgrD2e1lgrE1e1lgrE2e1lgrF1e1lgrF2e1lgrG1e1lgrG2e1lgrH1e1lgrH2e1lgrI1e1lgrI2e1lgrJ1e1lgrJ2e1lgrK1e1lgrK2e1lgrL1e1lgrL2
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06201 | DB00131 | AMP | 1lgr | e1lgrA1 | A:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrA2 | A:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrB1 | B:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrB2 | B:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrC1 | C:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrC2 | C:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrD1 | D:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrD2 | D:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrE1 | E:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrE2 | E:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrF1 | F:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrF2 | F:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrG1 | G:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrG2 | G:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrH1 | H:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrH2 | H:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrI1 | I:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrI2 | I:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrJ1 | J:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrJ2 | J:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrK1 | K:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrK2 | K:1-100 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrL1 | L:101-468 |
| P06201 | DB00131 | AMP | 1lgr | e1lgrL2 | L:1-100 |