Attributes
UniProt ID
Protein Name
Cholinesterase
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1P0I
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1p0iA1
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06276 | DB03814 | MES | 1p0i | e1p0iA1 | A:4-529 |
| P06276 | DB03814 | MES | 1p0m | e1p0mA1 | A:4-529 |
| P06276 | DB03814 | MES | 2j4c | e2j4cA1 | A:4-529 |
| P06276 | DB03814 | MES | 5nn0 | e5nn0A1 | A:3-529 |
| P06276 | DB03814 | MES | 6i0b | e6i0bA1 | A:4-529 |
| P06276 | DB03814 | MES | 6i0c | e6i0cA1 | A:4-529 |
| P06276 | DB03814 | MES | 6qaa | e6qaaA1 | A:4-529 |
| P06276 | DB03814 | MES | 6qab | e6qabA1 | A:4-529 |
| P06276 | DB03814 | MES | 6qad | e6qadA1 | A:4-529 |
| P06276 | DB03814 | MES | 7amz | e7amzA1 | A:3-529 |
| P06276 | DB03814 | MES | 7awg | e7awgA1 | A:4-529 |
| P06276 | DB03814 | MES | 7awh | e7awhA1 | A:4-529 |
| P06276 | DB03814 | MES | 7awi | e7awiA1 | A:4-529 |
| P06276 | DB03814 | MES | 7bgc | e7bgcA1 | A:3-529 |
| P06276 | DB03814 | MES | 7bo3 | e7bo3A1 | A:4-529 |
| P06276 | DB03814 | MES | 7bo4 | e7bo4A1 | A:4-529 |
| P06276 | DB03814 | MES | 7qbr | e7qbrA1 | A:3-529 |
| P06276 | DB03814 | MES | 7qhd | e7qhdA1 | A:3-529 |
| P06276 | DB03814 | MES | 7qhe | e7qheA1 | A:3-529 |
| P06276 | DB03814 | MES | 7zpb | e7zpbA1 | A:4-529 |
| P06276 | DB03814 | MES | 8cgo | e8cgoA1 | A:3-529 |