Attributes
UniProt ID
Protein Name
C-phycocyanin beta subunit
Ligand Name
PHYCOCYANOBILIN
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VXTXPYZGDQPMHK-GMXXPEQVSA-N
SMILES
CCC1C(C(=O)NC1=Cc2c(c(c([nH]2)C=C3C(=C(C(=N3)C=C4C(=C(C(=O)N4)CC)C)C)CCC(=O)O)CCC(=O)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4H0M
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4h0mA1e4h0mB1e4h0mC1e4h0mD1e4h0mE1e4h0mF1e4h0mG1e4h0mH1e4h0mI1e4h0mJ1e4h0mK1e4h0mL1e4h0mM1e4h0mN1e4h0mO1e4h0mP1e4h0mQ1e4h0mR1e4h0mS1e4h0mT1e4h0mU1e4h0mV1e4h0mW1e4h0mX1
ECOD domains from experimental PDB structures interacting with ligand CYC
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06539 | n/a | CYC | 4h0m | e4h0mB1 | B:1-172 |
| P06539 | n/a | CYC | 4h0m | e4h0mD1 | D:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mF1 | F:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mH1 | H:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mJ1 | J:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mL1 | L:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mN1 | N:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mP1 | P:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mR1 | R:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mT1 | T:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mV1 | V:0-171 |
| P06539 | n/a | CYC | 4h0m | e4h0mX1 | X:0-171 |
| P06539 | n/a | CYC | 7d6w | e7d6wB1 | B:1-172 |
| P06539 | n/a | CYC | 7d6w | e7d6wD1 | D:1-172 |
| P06539 | n/a | CYC | 7d6w | e7d6wF1 | F:1-172 |
| P06539 | n/a | CYC | 7d6w | e7d6wH1 | H:1-172 |
| P06539 | n/a | CYC | 7d6w | e7d6wJ1 | J:1-172 |
| P06539 | n/a | CYC | 7d6w | e7d6wL1 | L:1-172 |