Attributes
UniProt ID
Protein Name
Pyruvate decarboxylase
Ligand Name
2-{1-[(4-AMINO-2-METHYLPYRIMIDIN-5-YL)METHYL]-5-METHYL-1H-1,2,3-TRIAZOL-4-YL}ETHYL TRIHYDROGEN DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WHMXQEYVWLIXHH-UHFFFAOYSA-N
SMILES
Cc1c(nnn1Cc2cnc(nc2N)C)CCOP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2WVA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2wvaA1e2wvaA2e2wvaA3e2wvaB1e2wvaB2e2wvaB3e2wvaE1e2wvaE2e2wvaE3e2wvaF1e2wvaF2e2wvaF3e2wvaV1e2wvaV2e2wvaV3e2wvaX1e2wvaX2e2wvaX3e2wvaY1e2wvaY2e2wvaY3e2wvaZ1e2wvaZ2e2wvaZ3
ECOD domains from experimental PDB structures interacting with ligand TPU
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06672 | n/a | TPU | 2wva | e2wvaA2 | A:2-187 |
| P06672 | n/a | TPU | 2wva | e2wvaA3 | A:363-566 |
| P06672 | n/a | TPU | 2wva | e2wvaB2 | B:2-187 |
| P06672 | n/a | TPU | 2wva | e2wvaB3 | B:363-566 |
| P06672 | n/a | TPU | 2wva | e2wvaE2 | E:2-187 |
| P06672 | n/a | TPU | 2wva | e2wvaE3 | E:363-566 |
| P06672 | n/a | TPU | 2wva | e2wvaF2 | F:2-187 |
| P06672 | n/a | TPU | 2wva | e2wvaF3 | F:363-566 |
| P06672 | n/a | TPU | 2wva | e2wvaV2 | V:2-187 |
| P06672 | n/a | TPU | 2wva | e2wvaV3 | V:363-566 |
| P06672 | n/a | TPU | 2wva | e2wvaX2 | X:1-187 |
| P06672 | n/a | TPU | 2wva | e2wvaX3 | X:363-566 |
| P06672 | n/a | TPU | 2wva | e2wvaY2 | Y:2-187 |
| P06672 | n/a | TPU | 2wva | e2wvaY3 | Y:363-566 |
| P06672 | n/a | TPU | 2wva | e2wvaZ2 | Z:2-187 |
| P06672 | n/a | TPU | 2wva | e2wvaZ3 | Z:363-566 |
| P06672 | n/a | TPU | 2wvg | e2wvgA2 | A:2-187 |
| P06672 | n/a | TPU | 2wvg | e2wvgA3 | A:363-566 |
| P06672 | n/a | TPU | 2wvg | e2wvgB2 | B:2-187 |
| P06672 | n/a | TPU | 2wvg | e2wvgB3 | B:363-566 |
| P06672 | n/a | TPU | 2wvg | e2wvgE2 | E:2-187 |
| P06672 | n/a | TPU | 2wvg | e2wvgE3 | E:363-566 |
| P06672 | n/a | TPU | 2wvg | e2wvgF2 | F:2-187 |
| P06672 | n/a | TPU | 2wvg | e2wvgF3 | F:363-566 |