Attributes
UniProt ID
Protein Name
Glutathione reductase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1GER
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1gerA1e1gerA2e1gerA3e1gerB1e1gerB2e1gerB3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06715 | DB03147 | FAD | 1ger | e1gerA1 | A:336-450 |
| P06715 | DB03147 | FAD | 1ger | e1gerA2 | A:3-146,A:263-335 |
| P06715 | DB03147 | FAD | 1ger | e1gerA3 | A:147-262 |
| P06715 | DB03147 | FAD | 1ger | e1gerB1 | B:336-450 |
| P06715 | DB03147 | FAD | 1ger | e1gerB2 | B:3-146,B:263-335 |
| P06715 | DB03147 | FAD | 1ger | e1gerB3 | B:147-262 |
| P06715 | DB03147 | FAD | 1ges | e1gesA1 | A:336-450 |
| P06715 | DB03147 | FAD | 1ges | e1gesA2 | A:3-146,A:263-335 |
| P06715 | DB03147 | FAD | 1ges | e1gesA3 | A:147-262 |
| P06715 | DB03147 | FAD | 1ges | e1gesB1 | B:336-450 |
| P06715 | DB03147 | FAD | 1ges | e1gesB2 | B:3-146,B:263-335 |
| P06715 | DB03147 | FAD | 1ges | e1gesB3 | B:147-262 |
| P06715 | DB03147 | FAD | 1get | e1getA1 | A:336-450 |
| P06715 | DB03147 | FAD | 1get | e1getA2 | A:3-146,A:263-335 |
| P06715 | DB03147 | FAD | 1get | e1getA3 | A:147-262 |
| P06715 | DB03147 | FAD | 1get | e1getB1 | B:336-450 |
| P06715 | DB03147 | FAD | 1get | e1getB2 | B:3-146,B:263-335 |
| P06715 | DB03147 | FAD | 1get | e1getB3 | B:147-262 |
| P06715 | DB03147 | FAD | 1geu | e1geuA1 | A:336-450 |
| P06715 | DB03147 | FAD | 1geu | e1geuA2 | A:3-146,A:263-335 |
| P06715 | DB03147 | FAD | 1geu | e1geuA3 | A:147-262 |
| P06715 | DB03147 | FAD | 1geu | e1geuB1 | B:336-450 |
| P06715 | DB03147 | FAD | 1geu | e1geuB2 | B:3-146,B:263-335 |
| P06715 | DB03147 | FAD | 1geu | e1geuB3 | B:147-262 |