Attributes
UniProt ID
Protein Name
Glycogen phosphorylase, liver form
Ligand Name
CAFFEINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RYYVLZVUVIJVGH-UHFFFAOYSA-N
SMILES
Cn1cnc2c1C(=O)N(C(=O)N2C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1L5Q
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1l5qA1e1l5qA2e1l5qB1e1l5qB2
ECOD domains from experimental PDB structures interacting with ligand DB00201
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06737 | DB00201 | CFF | 1l5q | e1l5qA1 | A:485-830 |
| P06737 | DB00201 | CFF | 1l5q | e1l5qA2 | A:22-484 |
| P06737 | DB00201 | CFF | 1l5q | e1l5qB1 | B:485-830 |
| P06737 | DB00201 | CFF | 1l5q | e1l5qB2 | B:23-484 |
| P06737 | DB00201 | CFF | 1l7x | e1l7xA1 | A:22-484 |
| P06737 | DB00201 | CFF | 1l7x | e1l7xA2 | A:485-829 |
| P06737 | DB00201 | CFF | 1l7x | e1l7xB1 | B:20-484 |
| P06737 | DB00201 | CFF | 1l7x | e1l7xB2 | B:485-830 |
| P06737 | DB00201 | CFF | 3dd1 | e3dd1A1 | A:485-830 |
| P06737 | DB00201 | CFF | 3dd1 | e3dd1A2 | A:12-484 |
| P06737 | DB00201 | CFF | 3dd1 | e3dd1B1 | B:485-830 |
| P06737 | DB00201 | CFF | 3dd1 | e3dd1B2 | B:23-484 |
| P06737 | DB00201 | CFF | 3dds | e3ddsA1 | A:485-830 |
| P06737 | DB00201 | CFF | 3dds | e3ddsA2 | A:12-484 |
| P06737 | DB00201 | CFF | 3dds | e3ddsB1 | B:23-484 |
| P06737 | DB00201 | CFF | 3dds | e3ddsB2 | B:485-830 |
| P06737 | DB00201 | CFF | 3ddw | e3ddwA1 | A:485-830 |
| P06737 | DB00201 | CFF | 3ddw | e3ddwA2 | A:12-484 |
| P06737 | DB00201 | CFF | 3ddw | e3ddwB1 | B:485-830 |
| P06737 | DB00201 | CFF | 3ddw | e3ddwB2 | B:23-484 |