Attributes
UniProt ID
Protein Name
DNA polymerase beta
Ligand Name
2'-deoxy-5'-O-[(R)-hydroxy{[(R)-hydroxy(phosphonooxy)phosphoryl]amino}phosphoryl]cytidine
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
STYMTWKSQLVXJN-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(NP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4MFC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4mfcA1e4mfcA2e4mfcA3
ECOD domains from experimental PDB structures interacting with ligand 0KX
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06746 | n/a | 0KX | 4mfc | e4mfcA2 | A:149-335 |
| P06746 | n/a | 0KX | 4nlk | e4nlkA3 | A:149-335 |
| P06746 | n/a | 0KX | 4ny8 | e4ny8A2 | A:149-335 |
| P06746 | n/a | 0KX | 4o5k | e4o5kA1 | A:149-335 |
| P06746 | n/a | 0KX | 4pha | e4phaA1 | A:149-335 |
| P06746 | n/a | 0KX | 4phd | e4phdA1 | A:149-335 |
| P06746 | n/a | 0KX | 4tuq | e4tuqA1 | A:149-335 |
| P06746 | n/a | 0KX | 4tur | e4turA1 | A:149-335 |
| P06746 | n/a | 0KX | 4tus | e4tusA1 | A:149-335 |
| P06746 | n/a | 0KX | 4ymn | e4ymnA1 | A:149-335 |
| P06746 | n/a | 0KX | 4ymo | e4ymoA2 | A:149-335 |
| P06746 | n/a | 0KX | 4z6c | e4z6cA2 | A:149-335 |
| P06746 | n/a | 0KX | 5eoz | e5eozA1 | A:149-335 |
| P06746 | n/a | 0KX | 6cpq | e6cpqA1 | A:149-335 |
| P06746 | n/a | 0KX | 6cu9 | e6cu9A3 | A:149-335 |
| P06746 | n/a | 0KX | 7mz2 | e7mz2A2 | A:149-335 |
| P06746 | n/a | 0KX | 7mz8 | e7mz8A1 | A:149-335 |