Attributes
UniProt ID
Protein Name
DNA polymerase beta
Ligand Name
2'-DEOXYCYTIDINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NCMVOABPESMRCP-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6BEL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6belA1e6belA2e6belA3
ECOD domains from experimental PDB structures interacting with ligand DB03798
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06746 | DB03798 | DC | 6bel | e6belA1 | A:92-148 |
| P06746 | DB03798 | DC | 6bel | e6belA2 | A:10-91 |
| P06746 | DB03798 | DC | 6bel | e6belA3 | A:149-335 |
| P06746 | DB03798 | DC | 6bem | e6bemA1 | A:10-91 |
| P06746 | DB03798 | DC | 6bem | e6bemA2 | A:149-335 |
| P06746 | DB03798 | DC | 6bem | e6bemA3 | A:92-148 |
| P06746 | DB03798 | DC | 6ctq | e6ctqA1 | A:92-148 |
| P06746 | DB03798 | DC | 6ctq | e6ctqA2 | A:149-335 |
| P06746 | DB03798 | DC | 6ctq | e6ctqA3 | A:10-91 |
| P06746 | DB03798 | DC | 6ctr | e6ctrA1 | A:149-335 |
| P06746 | DB03798 | DC | 6ctr | e6ctrA2 | A:92-148 |
| P06746 | DB03798 | DC | 6ctr | e6ctrA3 | A:10-91 |
| P06746 | DB03798 | DC | 6ctt | e6cttA1 | A:10-91 |
| P06746 | DB03798 | DC | 6ctt | e6cttA2 | A:92-148 |
| P06746 | DB03798 | DC | 6ctt | e6cttA3 | A:149-335 |
| P06746 | DB03798 | DC | 6ctu | e6ctuA1 | A:92-148 |
| P06746 | DB03798 | DC | 6ctu | e6ctuA2 | A:10-91 |
| P06746 | DB03798 | DC | 6ctu | e6ctuA3 | A:149-335 |
| P06746 | DB03798 | DC | 6ctv | e6ctvA1 | A:10-91 |
| P06746 | DB03798 | DC | 6ctv | e6ctvA2 | A:92-148 |
| P06746 | DB03798 | DC | 6ctv | e6ctvA3 | A:149-335 |
| P06746 | DB03798 | DC | 6ctw | e6ctwA1 | A:10-91 |
| P06746 | DB03798 | DC | 6ctw | e6ctwA2 | A:149-335 |
| P06746 | DB03798 | DC | 6ctw | e6ctwA3 | A:92-148 |
| P06746 | DB03798 | DC | 6ctx | e6ctxA1 | A:92-148 |
| P06746 | DB03798 | DC | 6ctx | e6ctxA2 | A:149-335 |
| P06746 | DB03798 | DC | 6ctx | e6ctxA3 | A:10-91 |