Attributes
UniProt ID
Protein Name
DNA polymerase beta
Ligand Name
2'-DEOXYCYTIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGWHQCVHVJXOKC-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1MQ3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1mq3A1e1mq3A2e1mq3A3
ECOD domains from experimental PDB structures interacting with ligand DB03258
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06746 | DB03258 | DCP | 1mq3 | e1mq3A3 | A:149-335 |
| P06746 | DB03258 | DCP | 3rh5 | e3rh5A3 | A:149-335 |
| P06746 | DB03258 | DCP | 4kld | e4kldA3 | A:149-335 |
| P06746 | DB03258 | DCP | 4kle | e4kleA3 | A:149-335 |
| P06746 | DB03258 | DCP | 4klf | e4klfA3 | A:149-335 |
| P06746 | DB03258 | DCP | 4m9l | e4m9lA2 | A:149-335 |
| P06746 | DB03258 | DCP | 4rpx | e4rpxA2 | A:149-335 |
| P06746 | DB03258 | DCP | 4rpy | e4rpyA2 | A:149-335 |
| P06746 | DB03258 | DCP | 4rpz | e4rpzA3 | A:149-335 |
| P06746 | DB03258 | DCP | 4rq0 | e4rq0A2 | A:92-148 |
| P06746 | DB03258 | DCP | 5v1f | e5v1fA1 | A:149-335 |
| P06746 | DB03258 | DCP | 5v1n | e5v1nA1 | A:149-335 |
| P06746 | DB03258 | DCP | 5v1r | e5v1rA1 | A:149-335 |
| P06746 | DB03258 | DCP | 6ctq | e6ctqA2 | A:149-335 |
| P06746 | DB03258 | DCP | 6ph6 | e6ph6A2 | A:149-335 |
| P06746 | DB03258 | DCP | 7rbg | e7rbgA1 | A:149-335 |
| P06746 | DB03258 | DCP | 7rbh | e7rbhA3 | A:149-335 |
| P06746 | DB03258 | DCP | 7rbi | e7rbiA3 | A:149-335 |
| P06746 | DB03258 | DCP | 7rbj | e7rbjA1 | A:149-335 |
| P06746 | DB03258 | DCP | 7rbk | e7rbkA3 | A:149-335 |
| P06746 | DB03258 | DCP | 8ics | e8icsA3 | A:149-335 |
| P06746 | DB03258 | DCP | 8ict | e8ictA3 | A:149-335 |
| P06746 | DB03258 | DCP | 9icg | e9icgA3 | A:149-335 |
| P06746 | DB03258 | DCP | 9icr | e9icrA3 | A:149-335 |