Attributes
UniProt ID
Protein Name
DNA polymerase beta
Ligand Name
2'-DEOXYADENOSINE 5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SUYVUBYJARFZHO-RRKCRQDMSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3CC(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4KLQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4klqA1e4klqA2e4klqA3
ECOD domains from experimental PDB structures interacting with ligand DB03222
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06746 | DB03222 | DTP | 4klq | e4klqA3 | A:149-335 |
| P06746 | DB03222 | DTP | 4kls | e4klsA2 | A:10-91 |
| P06746 | DB03222 | DTP | 4kls | e4klsA3 | A:149-335 |
| P06746 | DB03222 | DTP | 4lvs | e4lvsA5 | A:149-335 |
| P06746 | DB03222 | DTP | 4m9n | e4m9nA5 | A:149-335 |
| P06746 | DB03222 | DTP | 4rq3 | e4rq3A1 | A:149-335 |
| P06746 | DB03222 | DTP | 4rq4 | e4rq4A3 | A:149-335 |
| P06746 | DB03222 | DTP | 4rq5 | e4rq5A3 | A:149-335 |
| P06746 | DB03222 | DTP | 6cr4 | e6cr4A2 | A:149-335 |
| P06746 | DB03222 | DTP | 8ica | e8icaA3 | A:149-335 |
| P06746 | DB03222 | DTP | 8ice | e8iceA3 | A:149-335 |
| P06746 | DB03222 | DTP | 8icf | e8icfA3 | A:149-335 |
| P06746 | DB03222 | DTP | 8ick | e8ickA3 | A:149-335 |
| P06746 | DB03222 | DTP | 8icl | e8iclA3 | A:149-335 |
| P06746 | DB03222 | DTP | 8icp | e8icpA3 | A:149-335 |
| P06746 | DB03222 | DTP | 8icr | e8icrA3 | A:149-335 |
| P06746 | DB03222 | DTP | 9icb | e9icbA3 | A:149-335 |
| P06746 | DB03222 | DTP | 9icc | e9iccA3 | A:149-335 |
| P06746 | DB03222 | DTP | 9icf | e9icfA3 | A:149-335 |
| P06746 | DB03222 | DTP | 9icq | e9icqA3 | A:149-335 |
| P06746 | DB03222 | DTP | 9icv | e9icvA3 | A:149-335 |