Attributes
UniProt ID
Protein Name
DNA polymerase beta
Ligand Name
2'-DEOXYURIDINE 5'-ALPHA,BETA-IMIDO-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XZLLMTSKYYYJLH-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)(NP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2FMQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2fmqA1e2fmqA2e2fmqA3
ECOD domains from experimental PDB structures interacting with ligand DB01965
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06746 | DB01965 | DUP | 2fmq | e2fmqA3 | A:149-335 |
| P06746 | DB01965 | DUP | 2fms | e2fmsA3 | A:149-335 |
| P06746 | DB01965 | DUP | 3c2k | e3c2kA3 | A:149-335 |
| P06746 | DB01965 | DUP | 4jwm | e4jwmA3 | A:149-335 |
| P06746 | DB01965 | DUP | 4jwn | e4jwnA3 | A:149-335 |
| P06746 | DB01965 | DUP | 4m9j | e4m9jA5 | A:149-335 |
| P06746 | DB01965 | DUP | 4r65 | e4r65A2 | A:149-335 |
| P06746 | DB01965 | DUP | 4r66 | e4r66A2 | A:149-335 |
| P06746 | DB01965 | DUP | 5j29 | e5j29A2 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2a | e5j2aA2 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2b | e5j2bA3 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2c | e5j2cA1 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2d | e5j2dA1 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2e | e5j2eA2 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2f | e5j2fA3 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2g | e5j2gA2 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2h | e5j2hA3 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2i | e5j2iA2 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2j | e5j2jA2 | A:149-335 |
| P06746 | DB01965 | DUP | 5j2k | e5j2kA3 | A:149-335 |
| P06746 | DB01965 | DUP | 6btf | e6btfA1 | A:149-335 |