Attributes
UniProt ID
Protein Name
DNA polymerase beta
Ligand Name
THYMIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NHVNXKFIZYSCEB-XLPZGREQSA-N
SMILES
CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4M9H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4m9hA1e4m9hA2e4m9hA3
ECOD domains from experimental PDB structures interacting with ligand DB02452
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06746 | DB02452 | TTP | 4m9h | e4m9hA1 | A:149-334 |
| P06746 | DB02452 | TTP | 5vrw | e5vrwA2 | A:149-335 |
| P06746 | DB02452 | TTP | 5vrx | e5vrxA3 | A:149-335 |
| P06746 | DB02452 | TTP | 5vry | e5vryA1 | A:149-335 |
| P06746 | DB02452 | TTP | 5vrz | e5vrzA2 | A:149-335 |
| P06746 | DB02452 | TTP | 5vs1 | e5vs1A1 | A:10-91 |
| P06746 | DB02452 | TTP | 5vs1 | e5vs1A2 | A:149-335 |
| P06746 | DB02452 | TTP | 5vs2 | e5vs2A1 | A:149-335 |
| P06746 | DB02452 | TTP | 5vs3 | e5vs3A1 | A:149-335 |
| P06746 | DB02452 | TTP | 5vs3 | e5vs3A2 | A:10-91 |
| P06746 | DB02452 | TTP | 8icj | e8icjA3 | A:149-335 |
| P06746 | DB02452 | TTP | 8icw | e8icwA3 | A:149-335 |
| P06746 | DB02452 | TTP | 8icx | e8icxA3 | A:149-335 |
| P06746 | DB02452 | TTP | 8icy | e8icyA3 | A:149-335 |
| P06746 | DB02452 | TTP | 9icu | e9icuA3 | A:149-335 |