Attributes
UniProt ID
Protein Name
Heme oxygenase 1
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6J79
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6j79A1e6j79A2e6j79A3e6j79A4e6j79A5e6j79B1e6j79B2e6j79B3e6j79B4e6j79B5
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P06762 | DB03147 | FAD | 6j79 | e6j79A3 | A:688-851 |
| P06762 | DB03147 | FAD | 6j79 | e6j79A4 | A:499-624 |
| P06762 | DB03147 | FAD | 6j79 | e6j79A5 | A:413-498,A:625-691 |
| P06762 | DB03147 | FAD | 6j79 | e6j79B3 | B:688-851 |
| P06762 | DB03147 | FAD | 6j79 | e6j79B4 | B:499-624 |
| P06762 | DB03147 | FAD | 6j79 | e6j79B5 | B:413-498,B:625-691 |
| P06762 | DB03147 | FAD | 6j7a | e6j7aA3 | A:692-855 |
| P06762 | DB03147 | FAD | 6j7a | e6j7aA4 | A:503-628 |
| P06762 | DB03147 | FAD | 6j7a | e6j7aA5 | A:417-502,A:629-695 |
| P06762 | DB03147 | FAD | 6j7a | e6j7aB3 | B:692-855 |
| P06762 | DB03147 | FAD | 6j7a | e6j7aB4 | B:503-628 |
| P06762 | DB03147 | FAD | 6j7a | e6j7aB5 | B:417-502,B:629-695 |
| P06762 | DB03147 | FAD | 6j7i | e6j7iA3 | A:690-853 |
| P06762 | DB03147 | FAD | 6j7i | e6j7iA4 | A:501-626 |
| P06762 | DB03147 | FAD | 6j7i | e6j7iA5 | A:415-500,A:627-693 |
| P06762 | DB03147 | FAD | 6j7i | e6j7iB3 | B:690-853 |
| P06762 | DB03147 | FAD | 6j7i | e6j7iB4 | B:501-626 |
| P06762 | DB03147 | FAD | 6j7i | e6j7iB5 | B:415-500,B:627-693 |