Attributes
UniProt ID
Protein Name
Succinate dehydrogenase iron-sulfur subunit
Ligand Name
2-METHYL-N-PHENYL-5,6-DIHYDRO-1,4-OXATHIINE-3-CARBOXAMIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
GYSSRZJIHXQEHQ-UHFFFAOYSA-N
SMILES
CC1=C(SCCO1)C(=O)Nc2ccccc2
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2WDQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2wdqA2e2wdqA3e2wdqA4e2wdqB1e2wdqB2e2wdqC1e2wdqD1e2wdqE2e2wdqE3e2wdqE4e2wdqF1e2wdqF2e2wdqG1e2wdqH1e2wdqI2e2wdqI3e2wdqI4e2wdqJ1e2wdqJ2e2wdqK1e2wdqL1
ECOD domains from experimental PDB structures interacting with ligand DB04657
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07014 | DB04657 | CBE | 2wdq | e2wdqB1 | B:107-238 |
| P07014 | DB04657 | CBE | 2wdq | e2wdqF1 | F:107-238 |
| P07014 | DB04657 | CBE | 2wdq | e2wdqJ1 | J:107-238 |
| P07014 | DB04657 | CBE | 2wp9 | e2wp9B1 | B:107-238 |
| P07014 | DB04657 | CBE | 2wp9 | e2wp9F1 | F:107-238 |
| P07014 | DB04657 | CBE | 2wp9 | e2wp9J1 | J:107-238 |
| P07014 | DB04657 | CBE | 2ws3 | e2ws3B1 | B:107-238 |
| P07014 | DB04657 | CBE | 2ws3 | e2ws3F1 | F:107-238 |
| P07014 | DB04657 | CBE | 2ws3 | e2ws3J1 | J:107-238 |
| P07014 | DB04657 | CBE | 2wu2 | e2wu2B1 | B:107-238 |
| P07014 | DB04657 | CBE | 2wu2 | e2wu2F1 | F:107-238 |
| P07014 | DB04657 | CBE | 2wu2 | e2wu2J1 | J:107-238 |
| P07014 | DB04657 | CBE | 2wu5 | e2wu5B1 | B:107-238 |
| P07014 | DB04657 | CBE | 2wu5 | e2wu5F1 | F:107-238 |
| P07014 | DB04657 | CBE | 2wu5 | e2wu5J1 | J:107-238 |