Attributes
UniProt ID
Protein Name
6-aminohexanoate-dimer hydrolase
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2DCF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2dcfA1e2dcfA2
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07061 | DB03814 | MES | 2dcf | e2dcfA2 | A:5-108,A:271-392 |
| P07061 | DB03814 | MES | 2e8i | e2e8iA5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 2zly | e2zlyA5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 2zm0 | e2zm0A5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 2zm2 | e2zm2A5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 2zm2 | e2zm2A6 | A:105-266 |
| P07061 | DB03814 | MES | 2zm7 | e2zm7A2 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 2zm8 | e2zm8A5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 2zm9 | e2zm9A5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 2zma | e2zmaA2 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 3a65 | e3a65A3 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 3a66 | e3a66A3 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 3vwl | e3vwlA5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 3vwm | e3vwmA5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 3vwn | e3vwnX5 | X:5-104,X:267-392 |
| P07061 | DB03814 | MES | 3vwp | e3vwpA5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 3vwq | e3vwqA5 | A:5-104,A:267-392 |
| P07061 | DB03814 | MES | 3vwr | e3vwrA5 | A:5-104,A:267-392 |