Attributes
UniProt ID
Protein Name
Fatty acid synthase subunit beta dehydratase ; Enoyl- reductase ; acetyltransferase ; malonyltransferase ; S-acyl fatty acid synthase thioesterase ]
Ligand Name
COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGJOEKWQDUBAIZ-IBOSZNHHSA-N
SMILES
CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8PRV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8prvB1e8prvG1e8prvG10e8prvG11e8prvG2e8prvG3e8prvG4e8prvG5e8prvG6e8prvG7e8prvG8e8prvG9
ECOD domains from experimental PDB structures interacting with ligand DB01992
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07149 | DB01992 | COA | 8prv | e8prvG10 | G:1834-1973 |
| P07149 | DB01992 | COA | 8prv | e8prvG11 | G:1658-1842,G:1974-2050 |
| P07149 | DB01992 | COA | 8prv | e8prvG7 | G:5-139 |
| P07149 | DB01992 | COA | 8prw | e8prwG1 | G:5-139 |
| P07149 | DB01992 | COA | 8prw | e8prwG11 | G:1834-1973 |
| P07149 | DB01992 | COA | 8prw | e8prwG9 | G:1658-1842,G:1974-2050 |
| P07149 | DB01992 | COA | 8prw | e8prwH2 | H:1834-1973 |
| P07149 | DB01992 | COA | 8prw | e8prwH5 | H:1658-1842,H:1974-2050 |
| P07149 | DB01992 | COA | 8prw | e8prwI2 | I:1658-1842,I:1974-2050 |
| P07149 | DB01992 | COA | 8prw | e8prwI7 | I:1834-1973 |
| P07149 | DB01992 | COA | 8prw | e8prwJ1 | J:1834-1973 |
| P07149 | DB01992 | COA | 8prw | e8prwJ7 | J:1658-1842,J:1974-2050 |
| P07149 | DB01992 | COA | 8prw | e8prwK11 | K:1834-1973 |
| P07149 | DB01992 | COA | 8prw | e8prwK6 | K:1658-1842,K:1974-2050 |
| P07149 | DB01992 | COA | 8prw | e8prwL10 | L:1658-1842,L:1974-2050 |
| P07149 | DB01992 | COA | 8prw | e8prwL4 | L:1834-1973 |
| P07149 | DB01992 | COA | 8ps1 | e8ps1G2 | G:1834-1973 |
| P07149 | DB01992 | COA | 8ps1 | e8ps1G3 | G:1658-1842,G:1974-2050 |
| P07149 | DB01992 | COA | 8ps1 | e8ps1G4 | G:5-139 |