Attributes
UniProt ID
Protein Name
Fatty acid synthase subunit beta dehydratase ; Enoyl- reductase ; acetyltransferase ; malonyltransferase ; S-acyl fatty acid synthase thioesterase ]
Ligand Name
NADP NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XJLXINKUBYWONI-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)OP(=O)(O)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6U5U
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6u5uA1e6u5uA2e6u5uA4e6u5uA5e6u5uA6e6u5uG1e6u5uG10e6u5uG11e6u5uG2e6u5uG3e6u5uG4e6u5uG5e6u5uG6e6u5uG7e6u5uG8e6u5uG9
ECOD domains from experimental PDB structures interacting with ligand DB03461
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07149 | DB03461 | NAP | 6u5u | e6u5uG5 | G:858-1052 |
| P07149 | DB03461 | NAP | 6u5u | e6u5uG9 | G:560-857,G:1053-1109 |
| P07149 | DB03461 | NAP | 8prv | e8prvG4 | G:858-1052 |
| P07149 | DB03461 | NAP | 8prv | e8prvG5 | G:560-857,G:1053-1109 |
| P07149 | DB03461 | NAP | 8prw | e8prwG5 | G:560-857,G:1053-1109 |
| P07149 | DB03461 | NAP | 8prw | e8prwG6 | G:858-1052 |
| P07149 | DB03461 | NAP | 8prw | e8prwH11 | H:560-857,H:1053-1109 |
| P07149 | DB03461 | NAP | 8prw | e8prwH7 | H:858-1052 |
| P07149 | DB03461 | NAP | 8prw | e8prwI11 | I:858-1052 |
| P07149 | DB03461 | NAP | 8prw | e8prwI6 | I:560-857,I:1053-1109 |
| P07149 | DB03461 | NAP | 8prw | e8prwJ11 | J:560-857,J:1053-1109 |
| P07149 | DB03461 | NAP | 8prw | e8prwJ5 | J:858-1052 |
| P07149 | DB03461 | NAP | 8prw | e8prwK5 | K:858-1052 |
| P07149 | DB03461 | NAP | 8prw | e8prwK8 | K:560-857,K:1053-1109 |
| P07149 | DB03461 | NAP | 8prw | e8prwL11 | L:858-1052 |
| P07149 | DB03461 | NAP | 8prw | e8prwL7 | L:560-857,L:1053-1109 |
| P07149 | DB03461 | NAP | 8ps1 | e8ps1G5 | G:560-857,G:1053-1109 |
| P07149 | DB03461 | NAP | 8ps1 | e8ps1G6 | G:858-1052 |