Attributes
UniProt ID
Protein Name
Fatty acid synthase subunit beta dehydratase ; Enoyl- reductase ; acetyltransferase ; malonyltransferase ; S-acyl fatty acid synthase thioesterase ]
Ligand Name
4'-PHOSPHOPANTETHEINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JDMUPRLRUUMCTL-VIFPVBQESA-N
SMILES
CC(C)(COP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6QL5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ql5A1e6ql5A2e6ql5A3e6ql5A4e6ql5A6e6ql5A7e6ql5B1e6ql5B2e6ql5B3e6ql5B4e6ql5B5e6ql5B7e6ql5C1e6ql5C2e6ql5C3e6ql5C4e6ql5C5e6ql5C7e6ql5D1e6ql5D2e6ql5D4e6ql5D5e6ql5D6e6ql5D7e6ql5E1e6ql5E2e6ql5E3e6ql5E4e6ql5E6e6ql5E7e6ql5F2e6ql5F3e6ql5F4e6ql5F5e6ql5F6e6ql5F7e6ql5G1e6ql5G10e6ql5G11e6ql5G2e6ql5G3e6ql5G4e6ql5G5e6ql5G6e6ql5G7e6ql5G8e6ql5G9e6ql5H1e6ql5H10e6ql5H11e6ql5H2e6ql5H3e6ql5H4e6ql5H5e6ql5H6e6ql5H7e6ql5H8e6ql5H9e6ql5I1e6ql5I10e6ql5I11e6ql5I2e6ql5I3e6ql5I4e6ql5I5e6ql5I6e6ql5I7e6ql5I8e6ql5I9e6ql5J1e6ql5J10e6ql5J11e6ql5J2e6ql5J3e6ql5J4e6ql5J5e6ql5J6e6ql5J7e6ql5J8e6ql5J9e6ql5K1e6ql5K10e6ql5K11e6ql5K2e6ql5K3e6ql5K4e6ql5K5e6ql5K6e6ql5K7e6ql5K8e6ql5K9e6ql5L1e6ql5L10e6ql5L11e6ql5L2e6ql5L3e6ql5L4e6ql5L5e6ql5L6e6ql5L7e6ql5L8e6ql5L9
ECOD domains from experimental PDB structures interacting with ligand DB03912
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07149 | DB03912 | PNS | 6ql5 | e6ql5G2 | G:316-422 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5G5 | G:140-315,G:423-559 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5H3 | H:140-315,H:423-559 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5H8 | H:316-422 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5I1 | I:316-422 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5I8 | I:140-315,I:423-559 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5J2 | J:140-315,J:423-559 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5J6 | J:316-422 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5K3 | K:140-315,K:423-559 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5K6 | K:316-422 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5L2 | L:316-422 |
| P07149 | DB03912 | PNS | 6ql5 | e6ql5L9 | L:140-315,L:423-559 |
| P07149 | DB03912 | PNS | 8psf | e8psfG6 | G:140-315,G:423-559 |
| P07149 | DB03912 | PNS | 8psf | e8psfG9 | G:316-422 |
| P07149 | DB03912 | PNS | 8psj | e8psjG3 | G:316-422 |
| P07149 | DB03912 | PNS | 8psj | e8psjG8 | G:140-315,G:423-559 |
| P07149 | DB03912 | PNS | 8psm | e8psmG1 | G:5-139 |
| P07149 | DB03912 | PNS | 8psm | e8psmG10 | G:1834-1973 |
| P07149 | DB03912 | PNS | 8psm | e8psmG7 | G:1658-1842,G:1974-2050 |
| P07149 | DB03912 | PNS | 8psp | e8pspG1 | G:316-422 |
| P07149 | DB03912 | PNS | 8psp | e8pspG9 | G:140-315,G:423-559 |