Attributes
UniProt ID
Protein Name
Phosphoenolpyruvate carboxykinase, cytosolic
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2QF2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2qf2A1e2qf2A2e2qf2B1e2qf2B2
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07379 | DB04315 | GDP | 2qf2 | e2qf2A1 | A:260-622 |
| P07379 | DB04315 | GDP | 2qf2 | e2qf2B1 | B:260-622 |
| P07379 | DB04315 | GDP | 3dtb | e3dtbA1 | A:260-622 |
| P07379 | DB04315 | GDP | 3dtb | e3dtbB1 | B:260-622 |
| P07379 | DB04315 | GDP | 3moh | e3mohA1 | A:260-622 |
| P07379 | DB04315 | GDP | 3moh | e3mohB1 | B:260-622 |
| P07379 | DB04315 | GDP | 4gmw | e4gmwA1 | A:260-622 |
| P07379 | DB04315 | GDP | 4gnl | e4gnlA1 | A:260-622 |
| P07379 | DB04315 | GDP | 4gnp | e4gnpA1 | A:260-622 |
| P07379 | DB04315 | GDP | 5fh5 | e5fh5A1 | A:260-622 |
| P07379 | DB04315 | GDP | 5v9h | e5v9hA1 | A:260-622 |
| P07379 | DB04315 | GDP | 5v9h | e5v9hB2 | B:260-622 |
| P07379 | DB04315 | GDP | 7l3m | e7l3mA1 | A:260-622 |
| P07379 | DB04315 | GDP | 7l3v | e7l3vA1 | A:260-622 |