Attributes
UniProt ID
Protein Name
Tubulin beta chain
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5N5N
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5n5nA1e5n5nA2e5n5nB1e5n5nB2e5n5nC1e5n5nC2e5n5nD1e5n5nD2e5n5nE1e5n5nE2e5n5nF1e5n5nF2e5n5nG1e5n5nG2e5n5nH1e5n5nH2e5n5nI1e5n5nI2e5n5nJ1e5n5nJ2e5n5nK1e5n5nK2e5n5nL1e5n5nL2
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07437 | DB04137 | GTP | 5n5n | e5n5nA1 | A:1-245 |
| P07437 | DB04137 | GTP | 5n5n | e5n5nA2 | A:246-436 |
| P07437 | DB04137 | GTP | 5n5n | e5n5nB1 | B:246-436 |
| P07437 | DB04137 | GTP | 5n5n | e5n5nC1 | C:246-436 |
| P07437 | DB04137 | GTP | 5n5n | e5n5nD1 | D:246-436 |
| P07437 | DB04137 | GTP | 5n5n | e5n5nE1 | E:246-436 |
| P07437 | DB04137 | GTP | 5n5n | e5n5nE2 | E:1-245 |
| P07437 | DB04137 | GTP | 5n5n | e5n5nF1 | F:246-436 |
| P07437 | DB04137 | GTP | 6qus | e6qusS2 | S:246-441 |
| P07437 | DB04137 | GTP | 6qus | e6qusU1 | U:246-441 |
| P07437 | DB04137 | GTP | 6qus | e6qusU2 | U:1-245 |
| P07437 | DB04137 | GTP | 6quy | e6quyG1 | G:246-440 |
| P07437 | DB04137 | GTP | 6quy | e6quyH2 | H:246-440 |
| P07437 | DB04137 | GTP | 6qvj | e6qvjS1 | S:246-440 |
| P07437 | DB04137 | GTP | 6qvj | e6qvjU1 | U:246-440 |
| P07437 | DB04137 | GTP | 6qvj | e6qvjU2 | U:1-245 |