Attributes
UniProt ID
Protein Name
n/a
Ligand Name
COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGJOEKWQDUBAIZ-IBOSZNHHSA-N
SMILES
CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1CQI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1cqiA1e1cqiA2e1cqiB1e1cqiB2e1cqiD1e1cqiD2e1cqiE1e1cqiE2
ECOD domains from experimental PDB structures interacting with ligand DB01992
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07459 | DB01992 | COA | 1cqi | e1cqiA1 | A:1-121 |
| P07459 | DB01992 | COA | 1cqi | e1cqiA2 | A:122-286 |
| P07459 | DB01992 | COA | 1cqi | e1cqiD1 | D:1-121 |
| P07459 | DB01992 | COA | 1cqi | e1cqiD2 | D:122-286 |
| P07459 | DB01992 | COA | 1cqj | e1cqjA1 | A:1-121 |
| P07459 | DB01992 | COA | 1cqj | e1cqjA2 | A:122-286 |
| P07459 | DB01992 | COA | 1cqj | e1cqjD1 | D:1-121 |
| P07459 | DB01992 | COA | 1cqj | e1cqjD2 | D:122-286 |
| P07459 | DB01992 | COA | 1jkj | e1jkjA1 | A:1-121 |
| P07459 | DB01992 | COA | 1jkj | e1jkjA2 | A:122-287 |
| P07459 | DB01992 | COA | 1jkj | e1jkjD1 | D:1-121 |
| P07459 | DB01992 | COA | 1jkj | e1jkjD2 | D:122-287 |
| P07459 | DB01992 | COA | 1jll | e1jllA1 | A:1-121 |
| P07459 | DB01992 | COA | 1jll | e1jllA2 | A:122-287 |
| P07459 | DB01992 | COA | 1jll | e1jllD1 | D:1-121 |
| P07459 | DB01992 | COA | 1jll | e1jllD2 | D:122-287 |
| P07459 | DB01992 | COA | 1scu | e1scuA1 | A:1-121 |
| P07459 | DB01992 | COA | 1scu | e1scuA2 | A:122-288 |
| P07459 | DB01992 | COA | 1scu | e1scuD1 | D:1-121 |
| P07459 | DB01992 | COA | 1scu | e1scuD2 | D:122-288 |
| P07459 | DB01992 | COA | 2scu | e2scuA1 | A:1-121 |
| P07459 | DB01992 | COA | 2scu | e2scuA2 | A:122-286 |
| P07459 | DB01992 | COA | 2scu | e2scuD1 | D:1-121 |
| P07459 | DB01992 | COA | 2scu | e2scuD2 | D:122-286 |