Attributes
UniProt ID
Protein Name
Pentafunctional AROM polypeptide
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1DQS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1dqsA1e1dqsA2e1dqsB1e1dqsB2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07547 | DB14128 | NAD | 1dqs | e1dqsA1 | A:183-391 |
| P07547 | DB14128 | NAD | 1dqs | e1dqsA2 | A:4-182 |
| P07547 | DB14128 | NAD | 1dqs | e1dqsB1 | B:183-391 |
| P07547 | DB14128 | NAD | 1dqs | e1dqsB2 | B:4-182 |
| P07547 | DB14128 | NAD | 1nr5 | e1nr5A1 | A:183-391 |
| P07547 | DB14128 | NAD | 1nr5 | e1nr5A2 | A:4-182 |
| P07547 | DB14128 | NAD | 1nr5 | e1nr5B1 | B:183-391 |
| P07547 | DB14128 | NAD | 1nr5 | e1nr5B2 | B:4-182 |
| P07547 | DB14128 | NAD | 1nrx | e1nrxA1 | A:183-391 |
| P07547 | DB14128 | NAD | 1nrx | e1nrxA2 | A:4-182 |
| P07547 | DB14128 | NAD | 1nrx | e1nrxB1 | B:183-391 |
| P07547 | DB14128 | NAD | 1nrx | e1nrxB2 | B:4-182 |
| P07547 | DB14128 | NAD | 1nvb | e1nvbA1 | A:183-391 |
| P07547 | DB14128 | NAD | 1nvb | e1nvbA2 | A:4-182 |
| P07547 | DB14128 | NAD | 1nve | e1nveA1 | A:183-391 |
| P07547 | DB14128 | NAD | 1nve | e1nveA2 | A:4-182 |
| P07547 | DB14128 | NAD | 1nve | e1nveB1 | B:183-391 |
| P07547 | DB14128 | NAD | 1nve | e1nveB2 | B:4-182 |
| P07547 | DB14128 | NAD | 1nve | e1nveC1 | C:183-391 |
| P07547 | DB14128 | NAD | 1nve | e1nveC2 | C:4-182 |
| P07547 | DB14128 | NAD | 1nve | e1nveD1 | D:183-391 |
| P07547 | DB14128 | NAD | 1nve | e1nveD2 | D:4-182 |
| P07547 | DB14128 | NAD | 1sg6 | e1sg6A1 | A:184-392 |
| P07547 | DB14128 | NAD | 1sg6 | e1sg6A2 | A:4-183 |
| P07547 | DB14128 | NAD | 1sg6 | e1sg6B1 | B:183-391 |
| P07547 | DB14128 | NAD | 1sg6 | e1sg6B2 | B:4-182 |