Attributes
UniProt ID
Protein Name
Adenine phosphoribosyltransferase
Ligand Name
1-O-pyrophosphono-5-O-phosphono-alpha-D-ribofuranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PQGCEDQWHSBAJP-TXICZTDVSA-N
SMILES
C(C1C(C(C(O1)OP(=O)(O)OP(=O)(O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1ZN7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1zn7A1e1zn7B1
ECOD domains from experimental PDB structures interacting with ligand DB01632
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07741 | DB01632 | PRP | 1zn7 | e1zn7A1 | A:3-177 |
| P07741 | DB01632 | PRP | 1zn7 | e1zn7B1 | B:3-177 |
| P07741 | DB01632 | PRP | 6fch | e6fchA1 | A:3-180 |
| P07741 | DB01632 | PRP | 6fch | e6fchB1 | B:3-180 |
| P07741 | DB01632 | PRP | 6fci | e6fciA1 | A:2-180 |
| P07741 | DB01632 | PRP | 6fci | e6fciB1 | B:4-180 |
| P07741 | DB01632 | PRP | 6fci | e6fciC1 | C:2-180 |
| P07741 | DB01632 | PRP | 6fci | e6fciD1 | D:4-180 |
| P07741 | DB01632 | PRP | 6fd4 | e6fd4A1 | A:3-180 |
| P07741 | DB01632 | PRP | 6fd4 | e6fd4B1 | B:3-180 |
| P07741 | DB01632 | PRP | 6fd5 | e6fd5A1 | A:3-180 |
| P07741 | DB01632 | PRP | 6fd5 | e6fd5B1 | B:4-180 |
| P07741 | DB01632 | PRP | 6hgq | e6hgqA1 | A:2-180 |
| P07741 | DB01632 | PRP | 6hgq | e6hgqB1 | B:4-180 |
| P07741 | DB01632 | PRP | 6hgq | e6hgqC1 | C:2-180 |
| P07741 | DB01632 | PRP | 6hgq | e6hgqD1 | D:4-180 |