Attributes
UniProt ID
Protein Name
Leucine--tRNA ligase
Ligand Name
5'-O-(L-leucylsulfamoyl)adenosine
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XFEDFDTWJLGMBO-LEJQEAHTSA-N
SMILES
CC(C)CC(C(=O)NS(=O)(=O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5OMW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5omwA1e5omwA2e5omwA3e5omwA5e5omwA6e5omwA7e5omwA8e5omwD2e5omwD4e5omwD5e5omwD6e5omwD7e5omwD8e5omwD9
ECOD domains from experimental PDB structures interacting with ligand LSS
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07813 | n/a | LSS | 5omw | e5omwA6 | A:619-796 |
| P07813 | n/a | LSS | 5omw | e5omwA8 | A:1-157,A:492-568 |
| P07813 | n/a | LSS | 5omw | e5omwD8 | D:619-796 |
| P07813 | n/a | LSS | 5omw | e5omwD9 | D:1-157,D:492-568 |
| P07813 | n/a | LSS | 5on2 | e5on2A1 | A:-1-148,A:490-567 |
| P07813 | n/a | LSS | 5on2 | e5on2A5 | A:568-618 |
| P07813 | n/a | LSS | 5on2 | e5on2A6 | A:619-796 |
| P07813 | n/a | LSS | 5on2 | e5on2D8 | D:619-796 |
| P07813 | n/a | LSS | 5on2 | e5on2D9 | D:1-157,D:492-568 |
| P07813 | n/a | LSS | 5on3 | e5on3A6 | A:619-796 |
| P07813 | n/a | LSS | 5on3 | e5on3A7 | A:1-157,A:492-568 |
| P07813 | n/a | LSS | 5on3 | e5on3D6 | D:619-796 |
| P07813 | n/a | LSS | 5on3 | e5on3D7 | D:1-157,D:492-568 |
| P07813 | n/a | LSS | 5onh | e5onhA6 | A:619-796 |
| P07813 | n/a | LSS | 5onh | e5onhA8 | A:1-148,A:490-568 |
| P07813 | n/a | LSS | 5onh | e5onhD7 | D:619-796 |
| P07813 | n/a | LSS | 5onh | e5onhD8 | D:1-148,D:490-568 |