Attributes
UniProt ID
Protein Name
Bifunctional glutamate/proline--tRNA ligase
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7Y1H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7y1hA1e7y1hA2e7y1hA3e7y1hB1e7y1hB2e7y1hB3
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07814 | DB00171 | ATP | 7y1h | e7y1hA2 | A:1016-1291 |
| P07814 | DB00171 | ATP | 7y1h | e7y1hA3 | A:1420-1512 |
| P07814 | DB00171 | ATP | 7y1h | e7y1hB1 | B:1420-1512 |
| P07814 | DB00171 | ATP | 7y1h | e7y1hB3 | B:1015-1291 |
| P07814 | DB00171 | ATP | 7y1w | e7y1wA2 | A:1016-1291 |
| P07814 | DB00171 | ATP | 7y28 | e7y28A1 | A:1420-1512 |
| P07814 | DB00171 | ATP | 7y28 | e7y28A3 | A:1016-1291 |
| P07814 | DB00171 | ATP | 7y28 | e7y28B1 | B:1016-1291 |
| P07814 | DB00171 | ATP | 7y28 | e7y28B2 | B:1420-1512 |
| P07814 | DB00171 | ATP | 7y3s | e7y3sA1 | A:1420-1512 |
| P07814 | DB00171 | ATP | 7y3s | e7y3sA2 | A:1016-1291 |
| P07814 | DB00171 | ATP | 7y3s | e7y3sB1 | B:1015-1291 |
| P07814 | DB00171 | ATP | 7y3s | e7y3sB3 | B:1420-1512 |