Attributes
UniProt ID
Protein Name
Major actin
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1C0F
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1c0fA1e1c0fA2e1c0fS1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07830 | DB00171 | ATP | 1c0f | e1c0fA1 | A:7-146 |
| P07830 | DB00171 | ATP | 1c0f | e1c0fA2 | A:147-371 |
| P07830 | DB00171 | ATP | 1c0g | e1c0gA1 | A:7-146 |
| P07830 | DB00171 | ATP | 1c0g | e1c0gA2 | A:147-371 |
| P07830 | DB00171 | ATP | 1dej | e1dejA1 | A:7-146 |
| P07830 | DB00171 | ATP | 1dej | e1dejA2 | A:147-371 |
| P07830 | DB00171 | ATP | 3a5m | e3a5mC3 | C:6-139 |
| P07830 | DB00171 | ATP | 3a5m | e3a5mC4 | C:140-375 |
| P07830 | DB00171 | ATP | 3a5n | e3a5nC3 | C:6-139 |
| P07830 | DB00171 | ATP | 3a5n | e3a5nC4 | C:140-375 |
| P07830 | DB00171 | ATP | 3a5o | e3a5oC3 | C:6-139 |
| P07830 | DB00171 | ATP | 3a5o | e3a5oC4 | C:140-375 |
| P07830 | DB00171 | ATP | 3chw | e3chwA3 | A:5-139 |
| P07830 | DB00171 | ATP | 3chw | e3chwA4 | A:140-375 |
| P07830 | DB00171 | ATP | 3ci5 | e3ci5A3 | A:4-139 |
| P07830 | DB00171 | ATP | 3ci5 | e3ci5A4 | A:140-375 |
| P07830 | DB00171 | ATP | 3cip | e3cipA3 | A:5-139 |
| P07830 | DB00171 | ATP | 3cip | e3cipA4 | A:140-375 |