Attributes
UniProt ID
Protein Name
Peroxisomal bifunctional enzyme
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3ZW9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3zw9A13e3zw9A14e3zw9A15e3zw9A16e3zw9B13e3zw9B14e3zw9B15e3zw9B16
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P07896 | DB14128 | NAD | 3zw9 | e3zw9A13 | A:293-476 |
| P07896 | DB14128 | NAD | 3zw9 | e3zw9A16 | A:477-611 |
| P07896 | DB14128 | NAD | 3zw9 | e3zw9B13 | B:293-476 |
| P07896 | DB14128 | NAD | 3zwc | e3zwcA13 | A:293-476 |
| P07896 | DB14128 | NAD | 3zwc | e3zwcA16 | A:477-611 |
| P07896 | DB14128 | NAD | 3zwc | e3zwcB13 | B:293-476 |
| P07896 | DB14128 | NAD | 5mgb | e5mgbA3 | A:477-611 |
| P07896 | DB14128 | NAD | 5mgb | e5mgbA4 | A:293-476 |
| P07896 | DB14128 | NAD | 5mgb | e5mgbB3 | B:293-476 |
| P07896 | DB14128 | NAD | 6z5f | e6z5fAAA1 | AAA:293-476 |
| P07896 | DB14128 | NAD | 6z5f | e6z5fAAA3 | AAA:477-611 |
| P07896 | DB14128 | NAD | 6z5f | e6z5fBBB1 | BBB:293-476 |
| P07896 | DB14128 | NAD | 6z5o | e6z5oAAA3 | AAA:293-476 |
| P07896 | DB14128 | NAD | 6z5v | e6z5vAAA2 | AAA:477-611 |
| P07896 | DB14128 | NAD | 6z5v | e6z5vAAA4 | AAA:293-476 |
| P07896 | DB14128 | NAD | 6z5v | e6z5vBBB2 | BBB:293-476 |