Attributes
UniProt ID
Protein Name
Neutrophil elastase
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3Q76
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3q76A1e3q76B1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P08246 | DB00141 | NAG | 3q76 | e3q76A1 | A:16-243 |
| P08246 | DB00141 | NAG | 3q76 | e3q76B1 | B:16-243 |
| P08246 | DB00141 | NAG | 3q77 | e3q77A1 | A:16-243 |
| P08246 | DB00141 | NAG | 5a09 | e5a09A1 | A:16-243 |
| P08246 | DB00141 | NAG | 5a0a | e5a0aE1 | E:16-243 |
| P08246 | DB00141 | NAG | 5a0b | e5a0bA1 | A:16-243 |
| P08246 | DB00141 | NAG | 5a8x | e5a8xA1 | A:16-243 |
| P08246 | DB00141 | NAG | 5a8z | e5a8zA1 | A:16-243 |
| P08246 | DB00141 | NAG | 6e69 | e6e69A1 | A:16-243 |
| P08246 | DB00141 | NAG | 6e69 | e6e69B1 | B:16-243 |
| P08246 | DB00141 | NAG | 6e69 | e6e69C1 | C:16-243 |
| P08246 | DB00141 | NAG | 6e69 | e6e69D1 | D:16-243 |
| P08246 | DB00141 | NAG | 7cbk | e7cbkB1 | B:16-243 |
| P08246 | DB00141 | NAG | 7cbk | e7cbkD1 | D:16-243 |
| P08246 | DB00141 | NAG | 8d4u | e8d4uA1 | A:29-246 |
| P08246 | DB00141 | NAG | 8d4u | e8d4uB1 | B:29-246 |
| P08246 | DB00141 | NAG | 8g26 | e8g26B1 | B:29-246 |