Attributes
UniProt ID
Protein Name
Neprilysin
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1DMT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1dmtA1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P08473 | DB00141 | NAG | 1dmt | e1dmtA1 | A:54-749 |
| P08473 | DB00141 | NAG | 1r1h | e1r1hA1 | A:54-749 |
| P08473 | DB00141 | NAG | 1r1i | e1r1iA1 | A:54-749 |
| P08473 | DB00141 | NAG | 1r1j | e1r1jA1 | A:54-749 |
| P08473 | DB00141 | NAG | 1y8j | e1y8jA1 | A:54-749 |
| P08473 | DB00141 | NAG | 2qpj | e2qpjA1 | A:54-749 |
| P08473 | DB00141 | NAG | 4cth | e4cthA1 | A:53-749 |
| P08473 | DB00141 | NAG | 5jmy | e5jmyA1 | A:54-749 |
| P08473 | DB00141 | NAG | 5jmy | e5jmyB1 | B:54-749 |
| P08473 | DB00141 | NAG | 6gid | e6gidA1 | A:54-749 |
| P08473 | DB00141 | NAG | 6sh1 | e6sh1AAA1 | AAA:54-749 |
| P08473 | DB00141 | NAG | 6sh1 | e6sh1CCC1 | CCC:54-749 |
| P08473 | DB00141 | NAG | 6sh2 | e6sh2AAA1 | AAA:54-749 |
| P08473 | DB00141 | NAG | 6suk | e6sukA1 | A:52-749 |
| P08473 | DB00141 | NAG | 6svy | e6svyA1 | A:53-749 |
| P08473 | DB00141 | NAG | 6thp | e6thpA1 | A:54-749 |
| P08473 | DB00141 | NAG | 6thp | e6thpB1 | B:54-749 |
| P08473 | DB00141 | NAG | 6xvp | e6xvpA1 | A:54-749 |