Attributes
UniProt ID
Protein Name
Glutathione S-transferase class-mu 26 kDa isozyme
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4AI6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4ai6A10e4ai6A11e4ai6A12e4ai6A13e4ai6A14e4ai6A15e4ai6A16e4ai6A17e4ai6A3e4ai6A4e4ai6A5e4ai6A6e4ai6A7e4ai6A8e4ai6A9e4ai6B1e4ai6B10e4ai6B11e4ai6B12e4ai6B13e4ai6B14e4ai6B15e4ai6B2e4ai6B3e4ai6B4e4ai6B5e4ai6B6e4ai6B7e4ai6B8e4ai6B9
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P08515 | DB00171 | ATP | 4ai6 | e4ai6A6 | A:2028-2217 |
| P08515 | DB00171 | ATP | 4ai6 | e4ai6A7 | A:2218-2377 |
| P08515 | DB00171 | ATP | 4ai6 | e4ai6A8 | A:2378-2564 |
| P08515 | DB00171 | ATP | 4ai6 | e4ai6B1 | B:2028-2217 |
| P08515 | DB00171 | ATP | 4ai6 | e4ai6B11 | B:2378-2564 |
| P08515 | DB00171 | ATP | 4ai6 | e4ai6B14 | B:2218-2377 |
| P08515 | DB00171 | ATP | 4akg | e4akgA6 | A:2028-2217 |
| P08515 | DB00171 | ATP | 4akg | e4akgA7 | A:2378-2564 |
| P08515 | DB00171 | ATP | 4akg | e4akgA9 | A:2218-2377 |
| P08515 | DB00171 | ATP | 4akg | e4akgB6 | B:2028-2217 |
| P08515 | DB00171 | ATP | 4akg | e4akgB7 | B:2378-2564 |
| P08515 | DB00171 | ATP | 4akg | e4akgB9 | B:2218-2377 |
| P08515 | DB00171 | ATP | 4akh | e4akhA6 | A:2028-2217 |
| P08515 | DB00171 | ATP | 4akh | e4akhA7 | A:2378-2564 |
| P08515 | DB00171 | ATP | 4akh | e4akhA9 | A:2218-2377 |
| P08515 | DB00171 | ATP | 4akh | e4akhB6 | B:2028-2217 |
| P08515 | DB00171 | ATP | 4akh | e4akhB7 | B:2378-2564 |
| P08515 | DB00171 | ATP | 4akh | e4akhB9 | B:2218-2377 |
| P08515 | DB00171 | ATP | 4aki | e4akiA6 | A:2028-2217 |
| P08515 | DB00171 | ATP | 4aki | e4akiA7 | A:2378-2564 |
| P08515 | DB00171 | ATP | 4aki | e4akiA9 | A:2218-2377 |
| P08515 | DB00171 | ATP | 4aki | e4akiB6 | B:2028-2217 |
| P08515 | DB00171 | ATP | 4aki | e4akiB7 | B:2378-2564 |
| P08515 | DB00171 | ATP | 4aki | e4akiB9 | B:2218-2377 |