Attributes
UniProt ID
Protein Name
Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Ligand Name
THIAMINE DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
AYEKOFBPNLCAJY-UHFFFAOYSA-O
SMILES
Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCOP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1NI4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ni4A1e1ni4B1e1ni4B2e1ni4C1e1ni4D1e1ni4D2
ECOD domains from experimental PDB structures interacting with ligand TPP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P08559 | n/a | TPP | 1ni4 | e1ni4A1 | A:1-361 |
| P08559 | n/a | TPP | 1ni4 | e1ni4C1 | C:1-361 |
| P08559 | n/a | TPP | 2ozl | e2ozlA1 | A:1-361 |
| P08559 | n/a | TPP | 2ozl | e2ozlC1 | C:1-361 |
| P08559 | n/a | TPP | 3exe | e3exeA1 | A:-1-361 |
| P08559 | n/a | TPP | 3exe | e3exeC1 | C:0-361 |
| P08559 | n/a | TPP | 3exe | e3exeE1 | E:1-361 |
| P08559 | n/a | TPP | 3exe | e3exeG1 | G:0-361 |
| P08559 | n/a | TPP | 3exf | e3exfA1 | A:0-361 |
| P08559 | n/a | TPP | 3exf | e3exfC1 | C:-1-361 |
| P08559 | n/a | TPP | 3exf | e3exfE1 | E:-1-361 |
| P08559 | n/a | TPP | 3exf | e3exfG1 | G:0-361 |
| P08559 | n/a | TPP | 3exh | e3exhA1 | A:0-361 |
| P08559 | n/a | TPP | 3exh | e3exhC1 | C:0-361 |
| P08559 | n/a | TPP | 3exh | e3exhE1 | E:0-258,E:283-361 |
| P08559 | n/a | TPP | 3exh | e3exhG1 | G:0-361 |
| P08559 | n/a | TPP | 6cer | e6cerA1 | A:-1-361 |
| P08559 | n/a | TPP | 6cer | e6cerC1 | C:2-257,C:281-361 |
| P08559 | n/a | TPP | 6cer | e6cerE1 | E:0-361 |
| P08559 | n/a | TPP | 6cer | e6cerG1 | G:-2-258,G:285-361 |