Attributes
UniProt ID
Protein Name
Myosin-2 heavy chain
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1G8X
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1g8xA1e1g8xA4e1g8xA5e1g8xA6e1g8xB1e1g8xB4e1g8xB5e1g8xB6
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P08799 | DB16833 | ADP | 1g8x | e1g8xA1 | A:80-763 |
| P08799 | DB16833 | ADP | 1g8x | e1g8xB1 | B:80-763 |
| P08799 | DB16833 | ADP | 1jwy | e1jwyA1 | A:91-776 |
| P08799 | DB16833 | ADP | 1jx2 | e1jx2A1 | A:91-776 |
| P08799 | DB16833 | ADP | 1mma | e1mmaA1 | A:78-759 |
| P08799 | DB16833 | ADP | 1mmd | e1mmdA2 | A:85-759 |
| P08799 | DB16833 | ADP | 1mnd | e1mndA1 | A:2-33,A:81-486,A:509-690 |
| P08799 | DB16833 | ADP | 1vom | e1vomA1 | A:2-31,A:78-747 |
| P08799 | DB16833 | ADP | 1w9i | e1w9iA2 | A:2-34,A:80-700,A:736-755 |
| P08799 | DB16833 | ADP | 1w9j | e1w9jA2 | A:1-34,A:80-755 |
| P08799 | DB16833 | ADP | 1w9k | e1w9kA1 | A:80-754 |
| P08799 | DB16833 | ADP | 1w9l | e1w9lA1 | A:1-34,A:80-747 |
| P08799 | DB16833 | ADP | 1yv3 | e1yv3A4 | A:2-33,A:81-702,A:736-747 |
| P08799 | DB16833 | ADP | 2y8i | e2y8iX3 | X:60-759 |
| P08799 | DB16833 | ADP | 3bz7 | e3bz7A2 | A:2-33,A:81-702,A:736-747 |
| P08799 | DB16833 | ADP | 3bz8 | e3bz8A4 | A:2-33,A:81-702,A:736-747 |
| P08799 | DB16833 | ADP | 3bz9 | e3bz9A1 | A:2-33,A:81-702,A:736-747 |
| P08799 | DB16833 | ADP | 3mkd | e3mkdA1 | A:2-34,A:80-693 |
| P08799 | DB16833 | ADP | 3myh | e3myhX2 | X:2-33,X:81-700,X:733-747 |
| P08799 | DB16833 | ADP | 4pjk | e4pjkA2 | A:1-31,A:78-701,A:722-731,A:735-747 |
| P08799 | DB16833 | ADP | 6z7u | e6z7uA1 | A:2-34,A:81-765 |