Attributes
UniProt ID
Protein Name
Gamma-enolase
Ligand Name
((3S,5S)-1,5-dihydroxy-3-methyl-2-oxopyrrolidin-3-yl)phosphonic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VVBLYPMICKYZTP-UCORVYFPSA-N
SMILES
CC1(CC(N(C1=O)O)O)P(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5EU9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5eu9A1e5eu9A2e5eu9B1e5eu9B2e5eu9C1e5eu9C2e5eu9D1e5eu9D2e5eu9E1e5eu9E2e5eu9F1e5eu9F2e5eu9G1e5eu9G2e5eu9H1e5eu9H2
ECOD domains from experimental PDB structures interacting with ligand 5TX
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P09104 | n/a | 5TX | 5eu9 | e5eu9A1 | A:2-140 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9A2 | A:141-434 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9B1 | B:141-434 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9B2 | B:2-140 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9C1 | C:141-437 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9C2 | C:2-140 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9D1 | D:141-434 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9D2 | D:2-140 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9E1 | E:2-140 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9E2 | E:141-434 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9F1 | F:141-435 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9F2 | F:2-140 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9G1 | G:141-434 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9G2 | G:2-140 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9H1 | H:141-434 |
| P09104 | n/a | 5TX | 5eu9 | e5eu9H2 | H:2-140 |
| P09104 | n/a | 5TX | 5tij | e5tijA1 | A:2-140 |
| P09104 | n/a | 5TX | 5tij | e5tijA2 | A:141-434 |
| P09104 | n/a | 5TX | 5tij | e5tijB1 | B:141-434 |
| P09104 | n/a | 5TX | 5tij | e5tijB2 | B:2-140 |