Attributes
UniProt ID
Protein Name
Glutathione S-transferase A2
Ligand Name
GLUTATHIONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RWSXRVCMGQZWBV-WDSKDSINSA-N
SMILES
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2WJU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2wjuA1e2wjuA2e2wjuB1e2wjuB2e2wjuC1e2wjuC2e2wjuD1e2wjuD2e2wjuE1e2wjuE2e2wjuF1e2wjuF2e2wjuG1e2wjuG2e2wjuH1e2wjuH2
ECOD domains from experimental PDB structures interacting with ligand DB00143
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P09210 | DB00143 | GSH | 2wju | e2wjuA1 | A:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuA2 | A:2-80 |
| P09210 | DB00143 | GSH | 2wju | e2wjuB1 | B:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuB2 | B:2-80 |
| P09210 | DB00143 | GSH | 2wju | e2wjuC1 | C:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuC2 | C:2-80 |
| P09210 | DB00143 | GSH | 2wju | e2wjuD1 | D:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuD2 | D:2-80 |
| P09210 | DB00143 | GSH | 2wju | e2wjuE1 | E:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuE2 | E:2-80 |
| P09210 | DB00143 | GSH | 2wju | e2wjuF1 | F:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuF2 | F:2-80 |
| P09210 | DB00143 | GSH | 2wju | e2wjuG1 | G:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuG2 | G:2-80 |
| P09210 | DB00143 | GSH | 2wju | e2wjuH1 | H:81-222 |
| P09210 | DB00143 | GSH | 2wju | e2wjuH2 | H:2-80 |
| P09210 | DB00143 | GSH | 4acs | e4acsA1 | A:81-222 |
| P09210 | DB00143 | GSH | 4acs | e4acsA2 | A:4-80 |
| P09210 | DB00143 | GSH | 4acs | e4acsB1 | B:81-220 |
| P09210 | DB00143 | GSH | 4acs | e4acsB2 | B:4-80 |
| P09210 | DB00143 | GSH | 4acs | e4acsC1 | C:81-222 |
| P09210 | DB00143 | GSH | 4acs | e4acsC2 | C:4-80 |
| P09210 | DB00143 | GSH | 4acs | e4acsD1 | D:81-220 |
| P09210 | DB00143 | GSH | 4acs | e4acsD2 | D:4-80 |