Attributes
UniProt ID
Protein Name
Poly polymerase 1 ADP-ribosyltransferase 1) polymerase 1, processed C-terminus ; Poly polymerase 1, processed N-terminus ]
Ligand Name
2-{4-[(3S)-piperidin-3-yl]phenyl}-2H-indazole-7-carboxamide
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PCHKPVIQAHNQLW-CQSZACIVSA-N
SMILES
c1cc2cn(nc2c(c1)C(=O)N)c3ccc(cc3)C4CCCNC4
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4R6E
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4r6eA1e4r6eA2e4r6eB1e4r6eB2e4r6eC1e4r6eC2e4r6eD1e4r6eD2
ECOD domains from experimental PDB structures interacting with ligand DB11793
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P09874 | DB11793 | 3JD | 4r6e | e4r6eA1 | A:782-1010 |
| P09874 | DB11793 | 3JD | 4r6e | e4r6eA2 | A:661-781 |
| P09874 | DB11793 | 3JD | 4r6e | e4r6eB1 | B:782-1011 |
| P09874 | DB11793 | 3JD | 4r6e | e4r6eB2 | B:662-781 |
| P09874 | DB11793 | 3JD | 4r6e | e4r6eC1 | C:661-781 |
| P09874 | DB11793 | 3JD | 4r6e | e4r6eC2 | C:782-1010 |
| P09874 | DB11793 | 3JD | 4r6e | e4r6eD1 | D:663-781 |
| P09874 | DB11793 | 3JD | 4r6e | e4r6eD2 | D:782-1010 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5A1 | A:782-1010 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5A2 | A:662-781 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5B1 | B:782-1010 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5B2 | B:662-781 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5C1 | C:661-796 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5C2 | C:797-1010 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5D1 | D:662-781 |
| P09874 | DB11793 | 3JD | 7kk5 | e7kk5D2 | D:782-1010 |