Attributes
UniProt ID
Protein Name
Furin
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5JMO
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5jmoA1e5jmoA2e5jmoB1e5jmoB2e5jmoC1e5jmoD1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P09958 | DB00141 | NAG | 5jmo | e5jmoA1 | A:110-442 |
| P09958 | DB00141 | NAG | 5jmo | e5jmoB2 | B:108-442 |
| P09958 | DB00141 | NAG | 7o1u | e7o1uA1 | A:110-443 |
| P09958 | DB00141 | NAG | 7o1w | e7o1wA1 | A:110-443 |
| P09958 | DB00141 | NAG | 7o1y | e7o1yA1 | A:110-443 |
| P09958 | DB00141 | NAG | 7o20 | e7o20A1 | A:110-443 |
| P09958 | DB00141 | NAG | 7o22 | e7o22A1 | A:111-443 |
| P09958 | DB00141 | NAG | 7qy0 | e7qy0A1 | A:110-442 |
| P09958 | DB00141 | NAG | 7qy0 | e7qy0A2 | A:443-581 |
| P09958 | DB00141 | NAG | 7qy1 | e7qy1A1 | A:110-442 |
| P09958 | DB00141 | NAG | 7qy1 | e7qy1A2 | A:443-580 |
| P09958 | DB00141 | NAG | 7qy2 | e7qy2A1 | A:443-580 |
| P09958 | DB00141 | NAG | 7qy2 | e7qy2A2 | A:110-442 |
| P09958 | DB00141 | NAG | 8b4v | e8b4vA1 | A:443-581 |
| P09958 | DB00141 | NAG | 8b4v | e8b4vA2 | A:110-442 |
| P09958 | DB00141 | NAG | 8b4w | e8b4wA1 | A:110-442 |
| P09958 | DB00141 | NAG | 8b4w | e8b4wA2 | A:443-581 |