Attributes
UniProt ID
Protein Name
Leukotriene A-4 hydrolase hydrolase
Ligand Name
2-(3-AMINO-2-HYDROXY-4-PHENYL-BUTYRYLAMINO)-4-METHYL-PENTANOIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VGGGPCQERPFHOB-RDBSUJKOSA-N
SMILES
CC(C)CC(C(=O)O)NC(=O)C(C(Cc1ccccc1)N)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1GW6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1gw6A1e1gw6A2e1gw6A3
ECOD domains from experimental PDB structures interacting with ligand DB03424
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P09960 | DB03424 | BES | 1gw6 | e1gw6A1 | A:1-208 |
| P09960 | DB03424 | BES | 1gw6 | e1gw6A2 | A:461-610 |
| P09960 | DB03424 | BES | 1gw6 | e1gw6A3 | A:209-460 |
| P09960 | DB03424 | BES | 1hs6 | e1hs6A1 | A:1-208 |
| P09960 | DB03424 | BES | 1hs6 | e1hs6A2 | A:461-610 |
| P09960 | DB03424 | BES | 1hs6 | e1hs6A3 | A:209-460 |
| P09960 | DB03424 | BES | 3ftx | e3ftxA1 | A:4-208 |
| P09960 | DB03424 | BES | 3ftx | e3ftxA2 | A:461-610 |
| P09960 | DB03424 | BES | 3ftx | e3ftxA3 | A:209-460 |
| P09960 | DB03424 | BES | 3fue | e3fueA1 | A:4-208 |
| P09960 | DB03424 | BES | 3fue | e3fueA2 | A:461-610 |
| P09960 | DB03424 | BES | 3fue | e3fueA3 | A:209-460 |
| P09960 | DB03424 | BES | 3fuf | e3fufA1 | A:4-208 |
| P09960 | DB03424 | BES | 3fuf | e3fufA2 | A:461-610 |
| P09960 | DB03424 | BES | 3fuf | e3fufA3 | A:209-460 |
| P09960 | DB03424 | BES | 3fuh | e3fuhA1 | A:4-208 |
| P09960 | DB03424 | BES | 3fuh | e3fuhA2 | A:461-610 |
| P09960 | DB03424 | BES | 3fuh | e3fuhA3 | A:209-460 |