Attributes
UniProt ID
Protein Name
Cell division protein FtsZ
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4DXD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4dxdA1e4dxdA2
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A031 | DB04315 | GDP | 4dxd | e4dxdA1 | A:12-205 |
| P0A031 | DB04315 | GDP | 5mn4 | e5mn4A2 | A:12-207 |
| P0A031 | DB04315 | GDP | 5mn6 | e5mn6A1 | A:13-207 |
| P0A031 | DB04315 | GDP | 5mn6 | e5mn6B1 | B:13-207 |
| P0A031 | DB04315 | GDP | 6kvp | e6kvpA1 | A:10-206 |
| P0A031 | DB04315 | GDP | 6kvq | e6kvqA1 | A:9-206 |
| P0A031 | DB04315 | GDP | 6rvn | e6rvnA2 | A:8-206 |
| P0A031 | DB04315 | GDP | 6rvp | e6rvpA1 | A:8-206 |
| P0A031 | DB04315 | GDP | 6rvq | e6rvqA2 | A:8-206 |
| P0A031 | DB04315 | GDP | 6si9 | e6si9A1 | A:9-206 |
| P0A031 | DB04315 | GDP | 6yd1 | e6yd1A1 | A:11-206 |
| P0A031 | DB04315 | GDP | 6yd5 | e6yd5A1 | A:9-206 |
| P0A031 | DB04315 | GDP | 6yd6 | e6yd6A1 | A:9-206 |
| P0A031 | DB04315 | GDP | 7ohh | e7ohhA1 | A:9-206 |
| P0A031 | DB04315 | GDP | 7ohk | e7ohkA1 | A:9-206 |
| P0A031 | DB04315 | GDP | 7ohl | e7ohlA1 | A:11-206 |
| P0A031 | DB04315 | GDP | 7ohn | e7ohnA1 | A:9-206 |
| P0A031 | DB04315 | GDP | 7oi2 | e7oi2A2 | A:9-206 |
| P0A031 | DB04315 | GDP | 7oja | e7ojaA2 | A:9-206 |
| P0A031 | DB04315 | GDP | 7ojb | e7ojbA1 | A:9-206 |
| P0A031 | DB04315 | GDP | 7ojc | e7ojcA1 | A:8-206 |
| P0A031 | DB04315 | GDP | 7ojd | e7ojdA1 | A:10-206 |
| P0A031 | DB04315 | GDP | 7on2 | e7on2A2 | A:9-206 |
| P0A031 | DB04315 | GDP | 7on3 | e7on3A1 | A:10-206 |
| P0A031 | DB04315 | GDP | 7on4 | e7on4A2 | A:8-206 |