Attributes
UniProt ID
Protein Name
Cysteine synthase A -lyase A
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1FCJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1fcjA1e1fcjA2e1fcjB1e1fcjB2e1fcjC1e1fcjC2e1fcjD1e1fcjD2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjA1 | A:1-148 |
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjA2 | A:149-302 |
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjB1 | B:1-148 |
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjB2 | B:149-304 |
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjC1 | C:149-304 |
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjC2 | C:1-148 |
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjD1 | D:1-148 |
| P0A1E3 | DB00114 | PLP | 1fcj | e1fcjD2 | D:149-302 |
| P0A1E3 | DB00114 | PLP | 1oas | e1oasA1 | A:149-315 |
| P0A1E3 | DB00114 | PLP | 1oas | e1oasA2 | A:1-148 |
| P0A1E3 | DB00114 | PLP | 1oas | e1oasB1 | B:149-315 |
| P0A1E3 | DB00114 | PLP | 1oas | e1oasB2 | B:1-148 |
| P0A1E3 | DB00114 | PLP | 6z4n | e6z4nAAA1 | AAA:-1-148 |
| P0A1E3 | DB00114 | PLP | 6z4n | e6z4nAAA2 | AAA:149-319 |
| P0A1E3 | DB00114 | PLP | 6z4n | e6z4nBBB1 | BBB:149-316 |
| P0A1E3 | DB00114 | PLP | 6z4n | e6z4nBBB2 | BBB:-1-148 |